|
|
| | 2-Chloro-4-fluorobenzyl bromide Basic information |
| Product Name: | 2-Chloro-4-fluorobenzyl bromide | | Synonyms: | 1-(BROMOMETHYL)-2-CHLORO-4-FLUOROBENZENE;à-bromo-2-chloro-4-fluorotoluene;2-Chloro-4-fluorobenzyl bromide,99%;2-choro-4-fluorobenzylbromide;2-Chloro-4-fluorobenzyl broMide, 99% 2.5GR;2-Chloro-4-fluorobenzyl broMide, 99% 25GR;1-(Bromomethyl)-2-chloro-4-fluorobenzene, alpha-Bromo-2-chloro-4-fluorotoluene;(2-chloro-4-fluorophenyl)methyl bromide | | CAS: | 45767-66-6 | | MF: | C7H5BrClF | | MW: | 223.47 | | EINECS: | 207-274-2 | | Product Categories: | Fluorine series | | Mol File: | 45767-66-6.mol |  |
| | 2-Chloro-4-fluorobenzyl bromide Chemical Properties |
| Melting point | 33-35°C | | Boiling point | 226.8±25.0 °C(Predicted) | | density | 1.3879 (rough estimate) | | refractive index | 1.5550 (estimate) | | storage temp. | Inert atmosphere,2-8°C | | solubility | soluble in Methanol | | form | Crystalline Low Melting Mass | | color | White to yellow | | Sensitive | Lachrymatory | | BRN | 3539265 | | InChI | InChI=1S/C7H5BrClF/c8-4-5-1-2-6(10)3-7(5)9/h1-3H,4H2 | | InChIKey | GAUUDQVOPUKGJD-UHFFFAOYSA-N | | SMILES | C1(CBr)=CC=C(F)C=C1Cl | | CAS DataBase Reference | 45767-66-6(CAS DataBase Reference) |
| Hazard Codes | C,Xn | | Risk Statements | 34-22 | | Safety Statements | 45-36/37/39-26 | | RIDADR | 3265 | | Hazard Note | Corrosive/Lachrymatory | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29039990 |
| | 2-Chloro-4-fluorobenzyl bromide Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | 2-Chloro-4-fluorobenzyl bromide is used as a reagent in the synthesis of a variety of compounds, such as pharmaceuticals, agrochemicals, and industrial chemicals. |
| | 2-Chloro-4-fluorobenzyl bromide Preparation Products And Raw materials |
|