- 4'-Bromo-4-cyano-biphenyl
-
- $5.00 / 1KG
-
2024-01-16
- CAS:57774-35-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 4'-Bromo-4-cyano-biphenyl Basic information |
| Product Name: | 4'-Bromo-4-cyano-biphenyl | | Synonyms: | 4'-Bromo-4-cyano-biphenyl;4'-bromo-[1,1'-biphenyl]-4-carbonitrile;4-(4'-Bromophenyl)benzonitrile;4'-Bromo-4-biphenylcarbonitrile;4'-Bromo-biphenyl-4-carbonitrile;[1,1'-Biphenyl]-4-carbonitrile, 4'-bromo-;4'-Bromo[1,1'-biphenyl]-4-carbonitrile;4'-Bromo-4-cyano-biphenyl | | CAS: | 57774-35-3 | | MF: | C13H8BrN | | MW: | 258.11332 | | EINECS: | 238-472-7 | | Product Categories: | | | Mol File: | 57774-35-3.mol |  |
| | 4'-Bromo-4-cyano-biphenyl Chemical Properties |
| Melting point | 144 °C(Solv: ethanol (64-17-5)) | | Boiling point | 120 °C(Press: 1 Torr) | | density | 1.48±0.1 g/cm3(Predicted) | | InChI | InChI=1S/C13H8BrN/c14-13-7-5-12(6-8-13)11-3-1-10(9-15)2-4-11/h1-8H | | InChIKey | BHVHKOVPWZKVCC-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(Br)C=C2)=CC=C(C#N)C=C1 |
| | 4'-Bromo-4-cyano-biphenyl Usage And Synthesis |
| | 4'-Bromo-4-cyano-biphenyl Preparation Products And Raw materials |
|