| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 18918157536; |
| Email: |
sales8178@energy-chemical.com |
|
| | (±)-cis-2-(Boc-aMino)-3-cyclohexene-1-carboxylic acid Basic information |
| Product Name: | (±)-cis-2-(Boc-aMino)-3-cyclohexene-1-carboxylic acid | | Synonyms: | (±)-cis-2-(Boc-aMino)-3-cyclohexene-1-carboxylic acid;QWRRLPZJKAWOFL-DTWKUNHWSA-N;3-Cyclohexene-1-carboxylic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]-, (1R,2S)-rel-;2-(Boc-NH)-cis-cyclohex-3-ene-COOH;(±)-cis-2-(Boc-amino)-3-cyclohexene-1-carboxylic acid;(±)-cis-2-(Boc-amino)-3-cyclohexene-1-carboxylic acid;(±)-cis-2-(Boc-aMino)-3-cyclohexene-1-carboxylic acid | | CAS: | 233600-33-4 | | MF: | C12H19NO4 | | MW: | 241.28 | | EINECS: | | | Product Categories: | | | Mol File: | 233600-33-4.mol |  |
| | (±)-cis-2-(Boc-aMino)-3-cyclohexene-1-carboxylic acid Chemical Properties |
| Melting point | 119-121 °C(Solvent: Hexane) | | Boiling point | 399.200±42.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.156±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | 2-8°C | | form | lumps | | pka | 4.420±0.40(predicted) | | BRN | 8320649 | | Major Application | peptide synthesis | | InChI | 1S/C12H19NO4/c1-12(2,3)17-11(16)13-9-7-5-4-6-8(9)10(14)15/h5,7-9H,4,6H2,1-3H3,(H,13,16)(H,14,15)/t8-,9+/m1/s1 | | InChIKey | QWRRLPZJKAWOFL-BDAKNGLRSA-N | | SMILES | CC(C)(C)OC(=O)N[C@H]1C=CCC[C@H]1C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | (±)-cis-2-(Boc-aMino)-3-cyclohexene-1-carboxylic acid Usage And Synthesis |
| | (±)-cis-2-(Boc-aMino)-3-cyclohexene-1-carboxylic acid Preparation Products And Raw materials |
|