BIS[2-(2-BUTOXYETHOXY)ETHYL] ADIPATE manufacturers
|
| | BIS[2-(2-BUTOXYETHOXY)ETHYL] ADIPATE Basic information |
| Product Name: | BIS[2-(2-BUTOXYETHOXY)ETHYL] ADIPATE | | Synonyms: | Wareflex;adipicacidbis(diethyleneglycolmonobutylether)ester;bis(diethyleneglycolmonobutylether)adipate;Bis[2-(2-butoxyethoxy)ethyl] hexanedioate;bisoflex111;hexanedioicacid,bis(2-(2-butoxyethoxy)ethyl)ester;Hexanedioicacid,bis[2-(2-butoxyethoxy)ethyl]ester;hexanedioicacidbis-(2-(2-butoxy-ethoxy)-ethyl)ester | | CAS: | 141-17-3 | | MF: | C22H42O8 | | MW: | 434.56 | | EINECS: | 205-465-5 | | Product Categories: | Plasticizers;Polymer Additives;Polymer Science | | Mol File: | 141-17-3.mol | ![BIS[2-(2-BUTOXYETHOXY)ETHYL] ADIPATE Structure](CAS/GIF/141-17-3.gif) |
| | BIS[2-(2-BUTOXYETHOXY)ETHYL] ADIPATE Chemical Properties |
| Melting point | −11 °C(lit.) | | Boiling point | 467.61°C (rough estimate) | | density | 1.01 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.448(lit.) | | Fp | >230 °F | | form | liquid | | Water Solubility | 570mg/L at 20℃ | | Henry's Law Constant | 3.2×107 mol/(m3Pa) at 25℃, HSDB (2015) | | InChI | InChI=1S/C22H42O8/c1-3-5-11-25-13-15-27-17-19-29-21(23)9-7-8-10-22(24)30-20-18-28-16-14-26-12-6-4-2/h3-20H2,1-2H3 | | InChIKey | SCABKEBYDRTODC-UHFFFAOYSA-N | | SMILES | C(OCCOCCOCCCC)(=O)CCCCC(OCCOCCOCCCC)=O | | LogP | 3.24 | | EPA Substance Registry System | Bis[2-(2-butoxyethoxy)ethyl] adipate (141-17-3) |
| Safety Statements | 24/25 | | WGK Germany | 2 | | RTECS | AU8420000 | | TSCA | TSCA listed | | HS Code | 29171900 | | Storage Class | 10 - Combustible liquids | | Hazardous Substances Data | 141-17-3(Hazardous Substances Data) | | Toxicity | LD50 oral in rat: 6gm/kg |
| | BIS[2-(2-BUTOXYETHOXY)ETHYL] ADIPATE Usage And Synthesis |
| Uses | Plasticizer | | Flammability and Explosibility | Not classified |
| | BIS[2-(2-BUTOXYETHOXY)ETHYL] ADIPATE Preparation Products And Raw materials |
|