- 5'-Guanylic acid
-
- $10.00 / 1KG
-
2026-01-05
- CAS:85-32-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
- 5'-Guanylic acid
-
- $45.00 / 1kg
-
2025-05-23
- CAS:85-32-5
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 20 tons
- 5'-Guanylic acid
-
- $10.00/ kg
-
2024-04-27
- CAS:85-32-5
- Min. Order: 1kg
- Purity: 99.7%
- Supply Ability: 200000kg
|
| | 5'-Guanylic acid Basic information |
| Product Name: | 5'-Guanylic acid | | Synonyms: | GUALOSINE 5'-PHOSPHATE (FEED ACID);GUANOSINE-5'-MONOPHOSPHATE (GMP) FREE ACID 98-100%;GUANOSINE-5'-MONOPHOSPHORIC ACID, 97.0%;[5-(2-amino-6-oxo-3H-purin-9-yl)-3,4-dihydroxy-oxolan-2-yl]methoxyphosphonic acid;GUANILICACID;GUANILLICACID;Guanylic Aicd;Guanosine-5''-monophosphoric acid (and/or unspecified salts) | | CAS: | 85-32-5 | | MF: | C10H14N5O8P | | MW: | 363.22 | | EINECS: | 201-598-8 | | Product Categories: | Pharmaceutical Intermediates | | Mol File: | 85-32-5.mol |  |
| | 5'-Guanylic acid Chemical Properties |
| Melting point | 220 - 223°C | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | solubility | DMSO (Very Slightly, Heated, Sonicated), Water (Slightly, Sonicated) | | form | Solid | | Boiling point | 64 °C(Press: 0.05 Torr) | | density | 2.47±0.1 g/cm3(Predicted) | | pKa | 1.86±0.10(Predicted) | | color | White to Off-White | | Odor | at 100.00?%. odorless | | Cosmetics Ingredients Functions | HUMECTANT
SKIN CONDITIONING
SKIN CONDITIONING - EMOLLIENT | | InChI | 1S/C10H14N5O8P/c11-10-13-7-4(8(18)14-10)12-2-15(7)9-6(17)5(16)3(23-9)1-22-24(19,20)21/h2-3,5-6,9,16-17H,1H2,(H2,19,20,21)(H3,11,13,14,18) | | InChIKey | RQFCJASXJCIDSX-UHFFFAOYSA-N | | SMILES | O=C(NC(N)=N1)C2=C1N(C=N2)C3C(O)C(C(COP(O)(O)=O)O3)O | | LogP | -2.000 | | CAS DataBase Reference | 85-32-5(CAS DataBase Reference) | | EPA Substance Registry System | 5'-Guanylic acid (85-32-5) |
| WGK Germany | WGK 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral | | Toxicity | LDLo intraperitoneal in mouse: 1500mg/kg |
| | 5'-Guanylic acid Usage And Synthesis |
| Uses | Biochemical research, flavor potentiator (disodium
salt).5-Guanylic Acid is a useful reagent for the chemo- and site-specific reductive amination of N2-guanine oligonucleotides. | | Definition | The monophosphoric ester of guanine, i.e., the nucleotide containing guanine, d-ribose, and phosphoric acid. The phosphate may be esterified to either the 2, 3, or 5 carbon of ribose, yielding guanosine-2′-phosphate, guanosine-3′-phosphate, and guanosine- | | Synthesis | Under low-temperature conditions, guanosine reacts with a phosphorylating agent (e.g., phosphorus oxychloride POCl3) in an organic solvent (e.g., trimethyl phosphate) to generate the intermediate dichlorophosphate. Subsequently, this intermediate is hydrolyzed in the presence of water or ice to convert into a monophosphate, thereby yielding the target product, 5'-Guanylic acid. | | Purification Methods | Crystallise it from water and dry it at 110o. [Beilstein 26 III/IV 3910.] |
| | 5'-Guanylic acid Preparation Products And Raw materials |
|