|
|
| | 5,7-Dichloro-1H-indole-2,3-dione Basic information |
| Product Name: | 5,7-Dichloro-1H-indole-2,3-dione | | Synonyms: | 1H-Indole-2,3-dione,5,7-dichloro-;AKOS BBS-00000998;BUTTPARK 50\07-99;IFLAB-BB F0020-1972;CHEMBRDG-BB 5228213;5,7-DICHLORO-1H-INDOLE-2,3-DIONE;5,7-DICHLOROISATIN;5,7-Dichloroindoline-2,3-dione | | CAS: | 6374-92-1 | | MF: | C8H3Cl2NO2 | | MW: | 216.02 | | EINECS: | 228-928-3 | | Product Categories: | IndolesBuilding Blocks;Halogenated Heterocycles;Heterocyclic Building Blocks;Indoles | | Mol File: | 6374-92-1.mol |  |
| | 5,7-Dichloro-1H-indole-2,3-dione Chemical Properties |
| Melting point | 218-223 °C(lit.) | | density | 1.643±0.06 g/cm3(Predicted) | | pka | 7.42±0.20(Predicted) | | InChI | InChI=1S/C8H3Cl2NO2/c9-3-1-4-6(5(10)2-3)11-8(13)7(4)12/h1-2H,(H,11,12,13) | | InChIKey | AYGGQJHJRFZDFH-UHFFFAOYSA-N | | SMILES | N1C2=C(C=C(Cl)C=C2Cl)C(=O)C1=O | | CAS DataBase Reference | 6374-92-1(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-41 | | Safety Statements | 37/39 | | WGK Germany | 2 |
| | 5,7-Dichloro-1H-indole-2,3-dione Usage And Synthesis |
| | 5,7-Dichloro-1H-indole-2,3-dione Preparation Products And Raw materials |
|