- N-BOC-IMIDAZOLE
-
- $1.00 / 1KG
-
2019-09-02
- CAS:49761-82-2
- Min. Order: 1KG
- Purity: >98%
- Supply Ability: 200kg
|
| | N-BOC-IMIDAZOLE Basic information |
| | N-BOC-IMIDAZOLE Chemical Properties |
| Melting point | 45-47 °C(lit.) | | Boiling point | 147-150 °C(lit.) | | density | 1.1835 (rough estimate) | | refractive index | 1.4200 (estimate) | | Fp | >230 °F | | storage temp. | 2-8°C | | solubility | Soluble in hexane, acetone, and DMF. | | pka | 3.49±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | Sensitive | Moisture Sensitive | | BRN | 607792 | | InChI | InChI=1S/C8H12N2O2/c1-8(2,3)12-7(11)10-5-4-9-6-10/h4-6H,1-3H3 | | InChIKey | MTBKGWHHOBJMHJ-UHFFFAOYSA-N | | SMILES | C1N(C(OC(C)(C)C)=O)C=CN=1 | | CAS DataBase Reference | 49761-82-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2933299090 |
| | N-BOC-IMIDAZOLE Usage And Synthesis |
| Chemical Properties | White powder | | Uses | 1-Boc-imidazole is used in the preparation of water soluble polyrotaxane, via modification of α-cyclodextrin in the presence of KOH and N,N?-carbonyldiimidazole. | | General Description | 1-(tert-butoxycarbonyl)imidazole is an imidazole derivative. Its gas-phase elimination kinetics study has been studied both theoretically and experimentally. |
| | N-BOC-IMIDAZOLE Preparation Products And Raw materials |
|