| Company Name: |
TCI Europe |
| Tel: |
320-37350700 |
| Email: |
sales@tcieurope.eu |
| Company Name: |
TCI AMERICA |
| Tel: |
800-4238616 |
| Email: |
sales@tciamerica.com |
|
| | 2-Bromo-3-tetradecylthiophene Basic information | | Uses |
| | 2-Bromo-3-tetradecylthiophene Chemical Properties |
| Boiling point | 399.9±22.0 °C(Predicted) | | density | 1.102±0.06 g/cm3(Predicted) | | refractive index | 1.6660 to 1.6700 | | form | clear liquid | | color | Colorless to Red to Green | | InChI | InChI=1S/C18H31BrS/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17-15-16-20-18(17)19/h15-16H,2-14H2,1H3 | | InChIKey | GOUPSYVDGUEWMF-UHFFFAOYSA-N | | SMILES | C1(Br)SC=CC=1CCCCCCCCCCCCCC |
| | 2-Bromo-3-tetradecylthiophene Usage And Synthesis |
| Uses | 2-Bromo-3-tetradecylthiophene is a useful research chemical. |
| | 2-Bromo-3-tetradecylthiophene Preparation Products And Raw materials |
|