|
|
| | (R)-3-Boc-aminocyclohexanone Basic information |
| Product Name: | (R)-3-Boc-aminocyclohexanone | | Synonyms: | (R)-3-Boc-aminocyclohexanone;tert-butyl (R)-(3-oxocyclohexyl)carbamate;Carbamic acid, N-[(1R)-3-oxocyclohexyl]-, 1,1-dimethylethyl ester;tert-butyl N-[(1R)-3-oxocyclohexyl]carbamate;tert-butyl N-[(1R)-3-oxocyclohexyl]carbamate - [B82667] | | CAS: | 1383797-87-2 | | MF: | C11H19NO3 | | MW: | 213.27 | | EINECS: | | | Product Categories: | | | Mol File: | 1383797-87-2.mol |  |
| | (R)-3-Boc-aminocyclohexanone Chemical Properties |
| Boiling point | 335.9±31.0 °C(Predicted) | | density | 1.06±0.1 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 12.01±0.20(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | 11.2°(C=0.01g/mI, MeOH , 20°C, 589nm) | | InChI | InChI=1S/C11H19NO3/c1-11(2,3)15-10(14)12-8-5-4-6-9(13)7-8/h8H,4-7H2,1-3H3,(H,12,14)/t8-/m1/s1 | | InChIKey | VGDCXKATFLOEHF-MRVPVSSYSA-N | | SMILES | C(OC(C)(C)C)(=O)N[C@@H]1CCCC(=O)C1 |
| | (R)-3-Boc-aminocyclohexanone Usage And Synthesis |
| | (R)-3-Boc-aminocyclohexanone Preparation Products And Raw materials |
|