|
|
| | α-Ketoglutaric acid disodium salt Basic information |
| | α-Ketoglutaric acid disodium salt Chemical Properties |
| density | 1.824 at 20℃ | | vapor pressure | 0.02Pa at 20-50℃ | | storage temp. | 2-8°C | | form | Crystalline Powder or Granules | | color | White | | Water Solubility | soluble | | Sensitive | Hygroscopic | | BRN | 5658566 | | InChI | InChI=1S/C5H6O5.2Na/c6-3(5(9)10)1-2-4(7)8;;/h1-2H2,(H,7,8)(H,9,10);;/q;2*+1/p-2 | | InChIKey | HSSWOFWCOAQLHZ-UHFFFAOYSA-L | | SMILES | C(=O)(C(=O)O[Na])CCC(=O)O[Na] | | LogP | -1.07 at 23℃ and pH7 | | Surface tension | 65.3mN/m at 1.02g/L and 20℃ | | CAS DataBase Reference | 305-72-6(CAS DataBase Reference) |
| | α-Ketoglutaric acid disodium salt Usage And Synthesis |
| Chemical Properties | White powder | | Uses | α-Ketoglutaric acid disodium salt dihydrate (2-Oxoglutaric acid disodium salt) may be used as starting reagent for the synthesis of deuteriated 2-oxo[3,3-2H2]glutarate disodium salt. | | Uses | Disodium 2-oxoglutarate dihydrate is suitable reagent used in a study to investigate the role of nitric oxide (NO) in mast cell physiology and biochemistry. | | General Description | α-Ketoglutaric acid disodium salt dihydrate (2-Oxoglutaric acid disodium salt) is the hydrated disodium salt of 2-oxoglutaric acid. | | Hazard | Moderately toxic by ingestion. |
| | α-Ketoglutaric acid disodium salt Preparation Products And Raw materials |
|