|
|
| | 4-(Trifluoromethyl)benzaldehyde Basic information |
| | 4-(Trifluoromethyl)benzaldehyde Chemical Properties |
| Melting point | 1-2°C | | Boiling point | 66-67 °C13 mm Hg(lit.) | | density | 1.275 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.463(lit.) | | Fp | 150 °F | | storage temp. | Inert atmosphere,2-8°C | | solubility | 1.5g/l | | form | Liquid | | Specific Gravity | 1.275 | | color | Clear colorless to yellow | | Water Solubility | Soluble in water. 1.5 g/L at 20°C | | Sensitive | Air Sensitive | | BRN | 1101680 | | InChI | 1S/C8H5F3O/c9-8(10,11)7-3-1-6(5-12)2-4-7/h1-5H | | InChIKey | BEOBZEOPTQQELP-UHFFFAOYSA-N | | SMILES | [H]C(=O)c1ccc(cc1)C(F)(F)F | | CAS DataBase Reference | 455-19-6(CAS DataBase Reference) | | NIST Chemistry Reference | p-CF3C6H4CHO(455-19-6) | | EPA Substance Registry System | Benzaldehyde, 4-(trifluoromethyl)- (455-19-6) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10-23 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HazardClass | IRRITANT, AIR SENSITIVE | | HS Code | 29130000 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 |
| | 4-(Trifluoromethyl)benzaldehyde Usage And Synthesis |
| Chemical Properties | Clear colorless to yellow liquid | | Uses | 4-(Trifluoromethyl)benzaldehyde is a reactant that has been used in the preparation of N,N''-(Arylmethylene)bisamides with cytotoxic activity as anti cancer agents. | | Definition | ChEBI: 4-(trifluoromethyl)benzaldehyde is a member of benzaldehydes. | | Synthesis | Using p-trifluoromethylaniline as raw material, p-trifluoromethylbenzaldehyde was produced by diazotization, oxidization and hydrolysis, with a yield of 35.9%
The mixture of halogenated hydrocarbon additives and p-trifluoromethylchlorobenzene was slowly added to tetrahydrofuran solution impregnated with magnesium chips to synthesize Grignard reagent for p-trifluoromethylchlorobenzene; N,N-dimethylformamide was added to the above Grignard reagent for p-trifluoromethylchlorobenzene to obtain the product by reaction.
|
| | 4-(Trifluoromethyl)benzaldehyde Preparation Products And Raw materials |
|