- 2,4,6-TRICHLORONITROBENZENE
-
- $5.00 / 1KG
-
2025-09-25
- CAS:18708-70-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 2,4,6-TRICHLORONITROBENZENE Basic information |
| Product Name: | 2,4,6-TRICHLORONITROBENZENE | | Synonyms: | 1,3,5-trichloro-2-nitro-benzen;1-Nitro-2,4,6-trichlorobenzene;2,4,6-Trichloro-1-nitrobenzene;Benzene,1,3,5-trichloro-2-nitro-;2-Nitro-1,3,5-trichlorobenzene~2,4,6-Trichloronitrobenzene;2,4,6-TRICHLORONITROBENZENE OEKANAL,250;2-Nitro-1,3,5-trichlorobenzene;1,3,5-TRICHLORO-2-NITROBENZENE | | CAS: | 18708-70-8 | | MF: | C6H2Cl3NO2 | | MW: | 226.44 | | EINECS: | 242-518-1 | | Product Categories: | Building Blocks;Chemical Synthesis;Halogenated;Nitro Compounds;Nitrogen Compounds;Organic Building Blocks;FINE Chemical & INTERMEDIATES;Nitro CompoundsVolatiles/ Semivolatiles;Alpha Sort;TP - TZ;T-ZAlphabetic;Nitro Compounds;Nitrogen Compounds;Organic Building Blocks;Analytical Standards;AromaticsChemical Class;Chemical Class;ChloroAnalytical Standards | | Mol File: | 18708-70-8.mol |  |
| | 2,4,6-TRICHLORONITROBENZENE Chemical Properties |
| Melting point | 70-72 °C | | Boiling point | 303.2±37.0 °C(Predicted) | | density | 1.651±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | methanol: 0.1 g/mL, clear | | form | Solid | | color | White to Pale Yellow | | BRN | 2213282 | | Stability: | Stable. Incompatible with strong bases, strong reducing agents, strong oxidizing agents. | | InChI | 1S/C6H2Cl3NO2/c7-3-1-4(8)6(10(11)12)5(9)2-3/h1-2H | | InChIKey | AEBJDOTVYMITIA-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1c(Cl)cc(Cl)cc1Cl | | CAS DataBase Reference | 18708-70-8(CAS DataBase Reference) | | EPA Substance Registry System | 2,4,6-Trichloronitrobenzene (18708-70-8) |
| Hazard Codes | T | | Risk Statements | 23/24/25-33 | | Safety Statements | 28-36/37/39-45 | | RIDADR | UN 1578 6.1/PG 2 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2904.99.4700 | | HazardClass | 6.1 | | PackingGroup | III | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Aquatic Chronic 4
STOT RE 2 |
| | 2,4,6-TRICHLORONITROBENZENE Usage And Synthesis |
| Chemical Properties | yellow solid | | Uses | 1,3,5-Trichloro-2-nitrobenzene is a building block for organic synthesis. | | General Description | Needles in alcohol or light beige crystals. | | Air & Water Reactions | Insoluble in water. | | Reactivity Profile | 2,4,6-TRICHLORONITROBENZENE is incompatible with strong bases and strong oxidizing agents. | | Health Hazard | SYMPTOMS: Absorption of a similar chemical into the body leads to formation of methemoglobin which in sufficient concentration causes cyanosis. | | Fire Hazard | Flash point data for 2,4,6-TRICHLORONITROBENZENE are not available; however, 2,4,6-TRICHLORONITROBENZENE is probably combustible. |
| | 2,4,6-TRICHLORONITROBENZENE Preparation Products And Raw materials |
|