|
|
| | 1-Aminocyclobutanecarboxylic acid Basic information |
| | 1-Aminocyclobutanecarboxylic acid Chemical Properties |
| Melting point | 261 °C (dec.)(lit.) | | Boiling point | 241.1±23.0 °C(Predicted) | | density | 1.290±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 2.38±0.20(Predicted) | | form | Powder | | color | White | | Water Solubility | Soluble to 100 mM in water. | | InChI | InChI=1S/C5H9NO2/c6-5(4(7)8)2-1-3-5/h1-3,6H2,(H,7,8) | | InChIKey | FVTVMQPGKVHSEY-UHFFFAOYSA-N | | SMILES | C1(N)(C(O)=O)CCC1 | | CAS DataBase Reference | 22264-50-2(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | GU1336000 | | HazardClass | IRRITANT | | HS Code | 2922498590 |
| | 1-Aminocyclobutanecarboxylic acid Usage And Synthesis |
| Uses | ACBC is an NMDA receptor antagonist acting at the glycine site. It acts as an agonist being an analog of glycine at the NMDA-glycine receptor site. This affects the signal transmission in the CNS. | | Uses | 1-Aminocyclobutanecarboxylic acid acts as an agonist being an analog of glycine at the NMDA-glycine receptor site. This affects the signal transmission in the CNS. | | Definition | ChEBI: 1-AMINOCYCLOBUTANE CARBOXYLIC ACID is a L-alpha-amino acid. | | Biological Activity | NMDA receptor antagonist acting at the glycine site. | | storage | Room temperature |
| | 1-Aminocyclobutanecarboxylic acid Preparation Products And Raw materials |
|