- GLORIOSINE
-
- $0.00 / 25kg
-
2024-04-12
- CAS:7411-12-3
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 2000ton
|
| | GLORIOSINE Basic information |
| Product Name: | GLORIOSINE | | Synonyms: | n-(5,6,7,9-tetrahydro-1,2,3,10-tetramethoxy-9-oxobenzo(a)heptalen-formamid;FORMYLDEACETYLCOLCHICINE,N-;GLORIOSINE;n-deacetyl-n-formyl-colchicin;n-deacetyl-n-formylcolchicine;N-FORMYLDEACETYLCOLCHICINE;N-[(7S)-5,6,7,9-Tetrahydro-1,2,3,10-tetraMethoxy-9-oxobenzo[a]heptalen-7-yl]forMaMide;N-ForMyl-N-desacetylcolchicine | | CAS: | 7411-12-3 | | MF: | C21H23NO6 | | MW: | 385.41 | | EINECS: | | | Product Categories: | Amines;Chiral Reagents;Heterocycles;Inhibitors;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 7411-12-3.mol |  |
| | GLORIOSINE Chemical Properties |
| Melting point | 264-267°C | | Boiling point | 715.8±60.0 °C(Predicted) | | density | 1.27±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer, Under Inert Atmosphere | | solubility | Chloroform (Sparingly, Heated, Sonicated), DMSO (Slightly, Heated) | | pka | 14.63±0.40(Predicted) | | form | Solid | | color | Yellow to Orange | | InChI | InChI=1S/C21H23NO6/c1-25-17-8-6-13-14(10-16(17)24)15(22-11-23)7-5-12-9-18(26-2)20(27-3)21(28-4)19(12)13/h6,8-11,15H,5,7H2,1-4H3,(H,22,23)/t15-/m0/s1 | | InChIKey | HDSXDWASQCHADG-HNNXBMFYSA-N | | SMILES | C(N[C@@H]1C2C(C3=C(OC)C(OC)=C(OC)C=C3CC1)=CC=C(OC)C(=O)C=2)=O |
| | GLORIOSINE Usage And Synthesis |
| Chemical Properties | Beige Solid | | Uses | Colchicine (C640000) derivative. A new alkaloid from Gloriosa superba. | | Definition | ChEBI: Gloriosine is a cyclic ketone. |
| | GLORIOSINE Preparation Products And Raw materials |
|