| Company Name: |
Rhawn Reagent Gold |
| Tel: |
400-1332688 18019345275 |
| Email: |
amy@rhawn.cn |
|
| | 2,4,6-Trimethoxy-1,3,5-triazine Basic information |
| Product Name: | 2,4,6-Trimethoxy-1,3,5-triazine | | Synonyms: | 2,4,6-Trimethoxy-[1,3,5]-triazin;2,4,6-Trimethoxy-s-triazine;s-Triazine, 2,4,6-trimethoxy-;Trimethyl cyanurate;Methyl cyanurate;1,3,5-Triazine, 2,4,6-trimethoxy-;trimethoxy-1,3,5-triazine;2,4,6-Trimethoxy-1,3,5-triazine?New | | CAS: | 877-89-4 | | MF: | C6H9N3O3 | | MW: | 171.15 | | EINECS: | 212-896-2 | | Product Categories: | Heterocyclic Compounds;Building Blocks;Heterocyclic Building Blocks;Triazines | | Mol File: | 877-89-4.mol |  |
| | 2,4,6-Trimethoxy-1,3,5-triazine Chemical Properties |
| Melting point | 135-137 °C(lit.) | | Boiling point | 301.12°C (rough estimate) | | density | 1.3994 (rough estimate) | | refractive index | 1.5800 (estimate) | | storage temp. | Storage temp. 2-8°C | | pka | 1.80±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C6H9N3O3/c1-10-4-7-5(11-2)9-6(8-4)12-3/h1-3H3 | | InChIKey | DFUGJTBMQKRCPI-UHFFFAOYSA-N | | SMILES | N1=C(OC)N=C(OC)N=C1OC |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2,4,6-Trimethoxy-1,3,5-triazine Usage And Synthesis |
| Uses | 2,4,6-Trimethoxy-1,3,5-triazine was used to investigate the molecularly imprinted solid phase extraction (MISPE) for the isolation of melamine (ML) in food products. | | General Description | 2,4,6-Trimethoxy-1,3,5-triazine (TMT) is a triazine derivative. It exists in three different polymorphic forms: α-, β- and γ-. 2,4,6-Trimethoxy-1,3,5-triazine molecules are planar in all the three polymorphs. Polymorphic forms differ in the mode of packing of the molecules in the crystal. Kinetics and mechanism of the reaction of radiolytically produced hydrated electron with TMT using pulse and steady-state radiolysis techniques has been studied. TMT undergoes methyl transfer in the melt and in the solid-state, to afford, 2,4,6-trioxo-1,3,5-trimethylazine. | | Synthesis | Cyanuric chloride (92 g,0.5 mol) was added to a mixture of NaOH (60 g, 1.5 mol) and MeOH (500 ml) in several small portions at a temperature of 0-5 C. After addition of all cyanuric chloride, the mixture was stirred at 20C for 2 hours. The solvent was evaporated in vacuum and the distillation residue was suspended in H2O (500 ml). The product was aspirated, washed with H2O (2 x 40 ml) and dried at room temperature and pressure. 2,4,6-Trimethoxy-1,3,5-triazine of formula VIIa (79 g, 92%) was obtained as a solid colorless substance. |
| | 2,4,6-Trimethoxy-1,3,5-triazine Preparation Products And Raw materials |
|