- PHENYL ACRYLATE
-
- $50.00 / 100kg
-
2025-10-13
- CAS:937-41-7
- Min. Order: 1kg
- Purity: 99%，Electronic grade(Single metal impurity≤ 100ppb)
- Supply Ability: 100kg
- Phenyl Acrylate
-
- $0.00 / 1kg
-
2024-09-26
- CAS:937-41-7
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 1000 kg/Month
- PHENYL ACRYLATE
-
- $9.80 / 1.79999995231628KG
-
2020-01-10
- CAS:937-41-7
- Min. Order: 1g
- Purity: ≥99%
- Supply Ability: 100kg
|
| | Phenyl Acrylate Basic information |
| Product Name: | Phenyl Acrylate | | Synonyms: | 2-propenoicacid,phenylester;Phenyl Acrylate (stabilized with BHT);Phenyl 2-propenoate;Phenyl acrylat;Phenyl propenoate;PHENYL ACRYLATE;Phenylacrylate,97%;acrylic acid phenyl ester | | CAS: | 937-41-7 | | MF: | C9H8O2 | | MW: | 148.16 | | EINECS: | 213-329-1 | | Product Categories: | monomer | | Mol File: | 937-41-7.mol |  |
| | Phenyl Acrylate Chemical Properties |
| Boiling point | 89-90°C 12mm | | density | 1,076 g/cm3 | | refractive index | 1.5210 | | Fp | 89-90°C/12mm | | storage temp. | 2-8°C | | form | clear liquid | | color | Colorless to Light yellow | | Water Solubility | Insoluble in water. | | BRN | 2041124 | | InChI | InChI=1S/C9H8O2/c1-2-9(10)11-8-6-4-3-5-7-8/h2-7H,1H2 | | InChIKey | WRAQQYDMVSCOTE-UHFFFAOYSA-N | | SMILES | C(OC1=CC=CC=C1)(=O)C=C | | EPA Substance Registry System | Phenyl acrylate (937-41-7) |
| Risk Statements | 36/37/38-51/53 | | Safety Statements | 26-36/37/39 | | RIDADR | UN3082 | | TSCA | TSCA listed | | HazardClass | 9 | | PackingGroup | III | | HS Code | 29161290 |
| Provider | Language |
|
ALFA
| English |
| | Phenyl Acrylate Usage And Synthesis |
| Chemical Properties | Colorless to Light yellow clear liquid. | | Uses | Phenyl acrylate reacts with benzaldehyde to produce 2-(hydroxy-phenyl-methyl)-acrylic acid phenyl ester. |
| | Phenyl Acrylate Preparation Products And Raw materials |
|