- 9-HEPTADECANOL
-
- $0.00 / 25kg
-
2024-03-28
- CAS:624-08-8
- Min. Order: 25kg
- Purity: 95%
- Supply Ability: Inquiry
- 9-HEPTADECANOL
-
- $0.10 / 1KG
-
2019-12-26
- CAS:624-08-8
- Min. Order: 1KG
- Purity: 95%-99%
- Supply Ability: 1kg; 100kg
|
| | 9-Heptadecanol Basic information |
| Product Name: | 9-Heptadecanol | | Synonyms: | 9-HEPTADECANOL;NISTC624088;9-Heptadecanol>;C89-OH;9-Heptadecanol,9-Hydroxy-heptadecan;Heptadecan-9-ol;9-Heptadecanol (6CI, 7CI, 8CI, 9CI, ACI);9-Hydroxy-heptadecan | | CAS: | 624-08-8 | | MF: | C17H36O | | MW: | 256.47 | | EINECS: | | | Product Categories: | OPV intermediate | | Mol File: | 624-08-8.mol |  |
| | 9-Heptadecanol Chemical Properties |
| Melting point | 58.0 to 62.0 °C | | Boiling point | 329.71°C (estimate) | | density | 0.8406 (estimate) | | refractive index | 1.4262 | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 15.28±0.20(Predicted) | | color | White to Light yellow | | InChI | InChI=1S/C17H36O/c1-3-5-7-9-11-13-15-17(18)16-14-12-10-8-6-4-2/h17-18H,3-16H2,1-2H3 | | InChIKey | WTWWTKPAEZQYPW-UHFFFAOYSA-N | | SMILES | CCCCCCCCC(O)CCCCCCCC | | LogP | 7.600 (est) |
| | 9-Heptadecanol Usage And Synthesis |
| Description | 9-Heptadecanol, or 9-Hydroxy-heptadecan, is a naturally occurring fatty alcohol derived from the oxidation of 9-hexadecenoic acid, commonly found in vegetable oils. It possesses several characteristics, including being a colorless, odorless, and waxy solid at room temperature, with a melting point of around 65° C. It is a significant component in the cuticular waxes of various plants and is a valuable intermediate compound in synthesizing other chemicals. |
| | 9-Heptadecanol Preparation Products And Raw materials |
|