| Company Name: |
VladaChem GmbH |
| Tel: |
+49-7246-3082843 +86-18411632868 |
| Email: |
info@vladachem.de |
|
| | 6,8-Difluoro-7-hydroxy-4-methylcoumarin Basic information |
| Product Name: | 6,8-Difluoro-7-hydroxy-4-methylcoumarin | | Synonyms: | 6,8-Difluoro-7-hydroxy-4-methyl-2H-1-benzopyran-2-one;2H-1-Benzopyran-2-one, 6,8-difluoro-7-hydroxy-4-methyl-;6,8-Difluoro-7-hydroxy-4-methylcoumarin (DIFMU);Hymecromone Impurity 5;DiFMU;6,8-Difluoro-7-hydroxy-4-methyl-2h-chromen-2-one;6,8-Difluoro-7-hydroxy-4-methylcoumarin | | CAS: | 215868-23-8 | | MF: | C10H6F2O3 | | MW: | 212.15 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 6,8-Difluoro-7-hydroxy-4-methylcoumarin Chemical Properties |
| Melting point | 213-215°C | | Boiling point | 332.3±42.0 °C(Predicted) | | density | 1.494±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Insoluble in water; soluble in chloroform,
N,N-dimethylformamide, dimethyl sulfoxide | | pka | 4.7, (at 22℃)
(calcd.) 5.50 ± 0.20, most acidic, temperature:
25 °C | | form | Off-White to Pale Yellow Soild | | color | Colorless needles; white solid | | λmax | 358 nm (Buffers pH 10.0, pH 9.0) | | ex/em | λex 358 nm; λem 450 nm; pH 9 | | Stability: | Hygroscopic | | Major Application | Detecting/quantifying/measuring metals (beryllium, chromium, lead) | | Biological Applications | Amplifying/detectingnucleic acid sequences; analyzing peptides, sugarchains; detecting bacteria; detecting/quantifyingnucleic acids; a substrate for measuring acylprotein thioesterase (APT) activity,, α-amylaseactivity, aryl sulfatases activity, β-galactosidasesactivity,,, guanidinobenzoatase activity, β-lactamaseactivity, lipase activity, phosphatases activity,,phospholipase LYPLAL activity, protein kinasesactivity, xylanase activity; diagnosing/treatingtraumatic brain injury; treating amyloidogenic disease;as temperature sensor, | | InChIKey | LLENVBUPWUQAGL-UHFFFAOYSA-N | | SMILES | FC1=C2C(C(C)=CC(O2)=O)=CC(F)=C1O |
| WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Skin Sens. 1 |
| | 6,8-Difluoro-7-hydroxy-4-methylcoumarin Usage And Synthesis |
| Uses | 6,8-Difluoro-7-hydroxy-4-methylcoumarin (DIFMU) was used for the diagnostic detection of natural killer cell-activity. | | Definition | ChEBI: 6,8-difluoro-7-hydroxy-4-methylcoumarin is a hydroxycoumarin. It has a role as a fluorochrome. | | Biological Activity | Fluorescent product of hydrolysis of fluorogenic phosphatase substrate DiFMUP.
DiFMU is a fluorescent product of hydrolysis of fluorogenic phosphatase substrate DiFMUP. DiFMU excitation wavelength is 358nm and emission can be detected at 455 nm. |
| | 6,8-Difluoro-7-hydroxy-4-methylcoumarin Preparation Products And Raw materials |
|