|
|
| | 6-Chloro-2-methyl-3-nitropyridine Basic information |
| | 6-Chloro-2-methyl-3-nitropyridine Chemical Properties |
| Melting point | 54-58 °C | | Boiling point | 200°C (rough estimate) | | density | 1.5610 (rough estimate) | | refractive index | 1.5500 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | Powder | | pka | -3.26±0.10(Predicted) | | color | Light beige to brown | | InChI | InChI=1S/C6H5ClN2O2/c1-4-5(9(10)11)2-3-6(7)8-4/h2-3H,1H3 | | InChIKey | GHSRMSJVYMITDX-UHFFFAOYSA-N | | SMILES | C1(C)=NC(Cl)=CC=C1[N+]([O-])=O | | CAS DataBase Reference | 22280-60-0(CAS DataBase Reference) |
| Provider | Language |
|
ACROS
| English |
| | 6-Chloro-2-methyl-3-nitropyridine Usage And Synthesis |
| Chemical Properties | Light yellow Cryst | | Uses | 6-Chloro-2-methyl-3-nitropyridine has been used as a reactant for the synthesis of fluorine-containing pyridinealdoxime derivatives as treatment of organophosphorus nerve-agent poisoning. | | Preparation | A mixture of 2-oxo-5-nitro-6-methyl-1,2-dihydropyridine, phosphorous oxychloride, and phosphorous pentachloride was heated at 110° C for 2 hours, whereupon the reaction mixture was charged with an additional portion of phosphorous pentachloride and phosphorous oxychloride. The reaction was stirred for 1 hour and then poured into ice water. The brown solid was filtered and washed with cold water, to give 6-Chloro-2-methyl-3-nitropyridine (94%).
 |
| | 6-Chloro-2-methyl-3-nitropyridine Preparation Products And Raw materials |
|