- Diethyl fluoromalonate
-
- $2.00 / 100kg
-
2025-10-13
- CAS:685-88-1
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
- Diethyl fluoromalonate
-
- $10.00 / 1kg
-
2025-05-23
- CAS:685-88-1
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 20 ton
|
| | Diethyl fluoromalonate Basic information |
| | Diethyl fluoromalonate Chemical Properties |
| Boiling point | 121-122 °C30 mm Hg(lit.) | | density | 1.129 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.407(lit.) | | Fp | 144 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 10.40±0.46(Predicted) | | form | Liquid | | Specific Gravity | 1.129 | | color | Clear colorless to pale yellow | | BRN | 1775686 | | InChI | InChI=1S/C7H11FO4/c1-3-11-6(9)5(8)7(10)12-4-2/h5H,3-4H2,1-2H3 | | InChIKey | GOWQBFVDZPZZFA-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C(F)C(OCC)=O | | CAS DataBase Reference | 685-88-1(CAS DataBase Reference) | | NIST Chemistry Reference | Diethyl fluoromalonate(685-88-1) |
| Hazard Codes | C,T | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45-25-27 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | RTECS | OO1670000 | | F | 19 | | Hazard Note | Corrosive | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29171900 |
| | Diethyl fluoromalonate Usage And Synthesis |
| Chemical Properties | CLEAR COLOURLESS TO PALE YELLOW LIQUID | | Uses | The kinetic parameters of diethyl fluoromalonate in hemolysates were used to study carboxylesterase activities in complex systems. | | General Description | The reaction of diethyl fluoromalonate with electron-poor and electron-rich, sterically hindered and unhindered aryl bromides and chlorides were studied. |
| | Diethyl fluoromalonate Preparation Products And Raw materials |
|