|
|
| | 4-tert-Butyl-2,6-diaminoanisole Basic information |
| Product Name: | 4-tert-Butyl-2,6-diaminoanisole | | Synonyms: | 2-Methoxy-5-tert-butylbenzene-1,3-diaMine;5-(Tert-butyl)-2-Methoxybenzene-1,3-diaMine;4-tert-Butyl-2,6-diaminoanisole;4-TERT-BUTYL-2,6-DIAMINOANISOLE-METHOXYBENZENE-1,3-DIAMINE,95%;4-tert-butyl-2,6-diamino-1-methoxybenzene;4-t-Butyl-2,6-diaminoanisole;4-TERT-BUTYL-2 6-DIAMINOANISOLE 97;4-t-butyl-2,6-diaminoanisol | | CAS: | 473269-70-4 | | MF: | C11H18N2O | | MW: | 194.27 | | EINECS: | | | Product Categories: | | | Mol File: | 473269-70-4.mol |  |
| | 4-tert-Butyl-2,6-diaminoanisole Chemical Properties |
| Melting point | 111-113 °C(lit.) | | storage temp. | 2-8°C, protect from light | | form | Powder | | color | White to orange | | InChI | InChI=1S/C11H18N2O/c1-11(2,3)7-5-8(12)10(14-4)9(13)6-7/h5-6H,12-13H2,1-4H3 | | InChIKey | SDOPSILBEXNRPI-UHFFFAOYSA-N | | SMILES | C1(N)=CC(C(C)(C)C)=CC(N)=C1OC |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 |
| | 4-tert-Butyl-2,6-diaminoanisole Usage And Synthesis |
| | 4-tert-Butyl-2,6-diaminoanisole Preparation Products And Raw materials |
|