|
|
| | 2-Methyl-3-butenoic acid Basic information |
| Product Name: | 2-Methyl-3-butenoic acid | | Synonyms: | CH2=CHCH(CH3)COOH;3-Butenoic acid, 2-Methyl-;2-Methyl-3-butenoie acid;2-Methylbut-3-enoic acid,98% (stabilized with MEHQ) | | CAS: | 53774-20-2 | | MF: | C5H8O2 | | MW: | 100.12 | | EINECS: | | | Product Categories: | | | Mol File: | 53774-20-2.mol |  |
| | 2-Methyl-3-butenoic acid Chemical Properties |
| Melting point | 20.44°C (estimate) | | Boiling point | 42-43 °C/0.1 mmHg(lit.) | | density | 0.968 g/mL at 20 °C | | refractive index | n20/D 1.424 | | Fp | 76 °C | | storage temp. | 2-8°C | | pka | 4.36±0.10(Predicted) | | form | clear liquid | | color | Colorless to Almost colorless | | InChI | InChI=1S/C5H8O2/c1-3-4(2)5(6)7/h3-4H,1H2,2H3,(H,6,7) | | InChIKey | GQWNPIKWYPQUPI-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(C)C=C | | LogP | 0.890 (est) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | 1760 | | HS Code | 2916.19.3000 | | HazardClass | 8 | | PackingGroup | III |
| | 2-Methyl-3-butenoic acid Usage And Synthesis |
| Definition | ChEBI: 2-methylbut-3-enoic acid is a branched-chain fatty acid. |
| | 2-Methyl-3-butenoic acid Preparation Products And Raw materials |
|