- 2,4,6-Trimethybromombenzene
-
- $100.00 / 1KG
-
2023-12-26
- CAS:576-83-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 2,4,6-Trimethybromombenzene Basic information |
| Product Name: | 2,4,6-Trimethybromombenzene | | Synonyms: | 2,4,6-trimethybromombenzene;2,4,6-TRIMETHYLBROMOBENZENE;2-Bromomesifylene;Mesitylene, 2-bromo-;TIMTEC-BB SBB007975;2-Bromo-1,3,5-trimethlybenzene;Benzene, 2-bromo-1,3,5-trimethyl-;2-BROMOM | | CAS: | 576-83-0 | | MF: | C9H11Br | | MW: | 199.09 | | EINECS: | 209-405-9 | | Product Categories: | Aromatic Hydrocarbons (substituted) & Derivatives | | Mol File: | 576-83-0.mol |  |
| | 2,4,6-Trimethybromombenzene Chemical Properties |
| Melting point | 2 °C(lit.) | | Boiling point | 225 °C(lit.) | | density | 1.301 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.552(lit.) | | Fp | 205 °F | | storage temp. | Sealed in dry,Room Temperature | | form | Liquid | | color | Clear colorless to very slightly yellow | | Water Solubility | Insoluble in water(20°C) . | | Sensitive | Light Sensitive | | BRN | 1907245 | | InChI | InChI=1S/C9H11Br/c1-6-4-7(2)9(10)8(3)5-6/h4-5H,1-3H3 | | InChIKey | RRTLQRYOJOSPEA-UHFFFAOYSA-N | | SMILES | C1(C)=CC(C)=CC(C)=C1Br | | CAS DataBase Reference | 576-83-0(CAS DataBase Reference) | | NIST Chemistry Reference | Benzene, 2-bromo-1,3,5-trimethyl-(576-83-0) | | EPA Substance Registry System | 2-Bromomesitylene (576-83-0) |
| | 2,4,6-Trimethybromombenzene Usage And Synthesis |
| Chemical Properties | colorless liquid | | Uses | 2-Bromomesitylene is a useful synthetic intermediate, Aromatics, Boron Derivatives, Catalyst. It is an intermediate used to prepare Hydrogen[4-[bis(2,4,6-trimethylphenyl)phosphino]-2,3,5,6-tetrafluorophenyl]hydrobis(2,3,4,5,6-pentafluorophenyl)borate (H714510) which is a frustrated phosphonium borate for metal-free catalytic hydrogenation of imines. |
| | 2,4,6-Trimethybromombenzene Preparation Products And Raw materials |
| Raw materials | Mesitylene-->1,3,5-TribroMo-2,4,6-TriMethyl-Benzene-->2,4-DIBROMOMESITYLENE | | Preparation Products | 2-METHOXY-3-PYRIDINECARBOXALDEHYDE-->3-METHOXY-PYRIDINE-2-CARBALDEHYDE-->Boron Standard Metal Solution-->3,4,5-TRIMETHYLBENZOIC ACID-->2,4,6-Trimethylbenzenesulfonic acid-->4-BROMO-3,5-DIMETHYL-BENZOIC ACID METHYL ESTER-->2,4,6-Trimethylbenzophenone-->1,3-BIS(2,4,6-TRIMETHYLPHENYL)-IMIDAZOLIDINIUM-CHLORIDE-->2-Bromo-benzene-1,3,5-tricarboxylic acid |
|