| Company Name: |
Mainchem Co., Ltd.
|
| Tel: |
+86-0592-6210733 |
| Email: |
sale@mainchem.com |
| Products Intro: |
Product Name:N-(PHENYLSELENO)PHTHALIMIDE CAS:71098-88-9
|
|
| | N-(PHENYLSELENO)PHTHALIMIDE Basic information |
| | N-(PHENYLSELENO)PHTHALIMIDE Chemical Properties |
| Melting point | 181-184 °C | | Boiling point | 445.4±28.0 °C(Predicted) | | storage temp. | -20°C | | pka | -2.90±0.20(Predicted) | | Sensitive | Air Sensitive | | BRN | 1468701 | | InChI | 1S/C14H9NO2Se/c16-13-11-8-4-5-9-12(11)14(17)15(13)18-10-6-2-1-3-7-10/h1-9H | | InChIKey | TYZFQSLJTWPSDS-UHFFFAOYSA-N | | SMILES | O=C1N([Se]c2ccccc2)C(=O)c3ccccc13 | | CAS DataBase Reference | 71098-88-9(CAS DataBase Reference) |
| Hazard Codes | N-T,N,T | | Risk Statements | 50/53-33-23/25 | | Safety Statements | 61-60-45-28A-20/21-28 | | RIDADR | 3283 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | II | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 STOT RE 2 |
| | N-(PHENYLSELENO)PHTHALIMIDE Usage And Synthesis |
| Chemical Properties | white to light yellow crystalline powder | | Uses | N-(Phenylseleno)phthalimide is a versatile selenamide reagent and has been used:
- to selectively derivatize thiols for mass spectrometric analysis
- to derivatize thiol peptides in protein digests
- in L-prolinamide or pyrrolidine trifluoromethanesulfonamide promoted α-selenenylation reactions of aldehydes and ketones
- for introducing PhSe into protected glycals, ketones, aldehydes, stannanes and exocyclic alkenes
| | Preparation | N-(Phenylseleno)phthalimide can be prepared in 87% yield by the reaction of Benzeneselenenyl Chloride with potassium Phthalimide in hexane. | | storage | indefinitely stable when stored at -20 °C in the dark. |
| | N-(PHENYLSELENO)PHTHALIMIDE Preparation Products And Raw materials |
|