|
|
| | Cupric acetylacetonate Basic information |
| | Cupric acetylacetonate Chemical Properties |
| Melting point | 284-288 °C (dec.) (lit.) | | Boiling point | 160 °C (9.7513 mmHg) | | bulk density | 200-400kg/m3 | | density | 0.721 g/cm3 | | vapor pressure | 0.13 hPa (163 °C) | | Fp | 160°C/10mm | | storage temp. | Store below +30°C. | | solubility | 0.2g/l | | form | Crystalline Powder | | color | Blue to blue-grayish | | Specific Gravity | 1.594 | | Water Solubility | 0.2 g/L (20 ºC) | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | Sublimation | 160 ºC | | BRN | 4157957 | | Exposure limits | ACGIH: TWA 1 mg/m3 NIOSH: IDLH 100 mg/m3; TWA 1 mg/m3 | | Stability: | Stable. Incompatible with strong oxidizing agents. | | InChI | 1S/2C5H8O2.Cu/c2*1-4(6)3-5(2)7;/h2*3,6H,1-2H3;/q;;+2/p-2/b2*4-3-; | | InChIKey | QYJPSWYYEKYVEJ-FDGPNNRMSA-L | | SMILES | CC(=O)\C=C(\C)O[Cu]O\C(C)=C/C(C)=O | | NIST Chemistry Reference | Copper, bis(2,4-pentanedionato-o,o')-(13395-16-9) | | EPA Substance Registry System | Copper, bis(2,4-pentanedionato-.kappa.O,.kappa.O')-, (SP-4-1)- (13395-16-9) |
| | Cupric acetylacetonate Usage And Synthesis |
| Chemical Properties | crystalline solid | | Uses | Copper(II) acetylacetonate catalyzes coupling and carbene transfer reactions. Metal acetylacetonates are used as catalysts for polymerization of olefins and transesterification. They are used as PVC stabilizer. They are used as curing agents for epoxy resins, acrylic adhesives and silicone rubbers. They are used as solvents, lubricant additives, paint drier, and pesticides. They are used in glass coatings. | | Definition | Crystalline powder, slightly soluble in water and
alcohol, soluble in chloroform, mp >230C. Resistant to hydrolysis. A chelating nonionizing compound. | | reaction suitability | core: copper reagent type: catalyst | | Safety Profile | Poison by intravenous andintraperitoneal routes. When heated to decomposition it emits acrid smoke andfumes of Cu. |
| | Cupric acetylacetonate Preparation Products And Raw materials |
|