|
|
| | 2-Methyl-3-trifluoromethylaniline Basic information |
| | 2-Methyl-3-trifluoromethylaniline Chemical Properties |
| Melting point | 38-42 °C(lit.) | | Boiling point | 62-64°C 4mm | | density | 1.237±0.06 g/cm3(Predicted) | | Fp | >210 °F | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | pka | 3.23±0.10(Predicted) | | form | Crystalline Powder | | color | White | | BRN | 2832865 | | InChI | InChI=1S/C8H8F3N/c1-5-6(8(9,10)11)3-2-4-7(5)12/h2-4H,12H2,1H3 | | InChIKey | TWLDBACVSHADLI-UHFFFAOYSA-N | | SMILES | C1(N)=CC=CC(C(F)(F)F)=C1C | | CAS DataBase Reference | 54396-44-0(CAS DataBase Reference) |
| Hazard Codes | Xi,T,T+ | | Risk Statements | 36/37/38-26/27/28 | | Safety Statements | 26-36-24/25 | | RIDADR | 2811 | | WGK Germany | 3 | | Hazard Note | Toxic | | HazardClass | IRRITANT | | HazardClass | 6.1 | | HS Code | 29214990 | | Storage Class | 11 - Combustible Solids |
| | 2-Methyl-3-trifluoromethylaniline Usage And Synthesis |
| Chemical Properties | White crystalline powder | | Uses | 2-Methyl-3-trifluoromethylaniline is a reactant in the synthesis of methylguanidine derivatives as prospective PET radioligands for the open channel of the NMDA receptor, linked to Alzheimer’s, epilepsy and other neurodegenerative disorders. | | General Description | 2-Methyl-3-(trifluoromethyl)aniline belongs to the trifluoromethylbenzene series. | | Synthesis |
A method for synthesizing 2-methyl-3-trifluoromethyl aniline, which takes 2-chloro-3-trifluoromethyl aniline as a raw material, introduces methylthio on the 2-chloro-3-trifluoromethyl aniline, reacts with sulfonyl chloride to convert the methylthio into chloromethyl, and then neutralizes and hydrogenates to obtain pure 2-Methyl-3-trifluoromethylaniline.
| | References | [1] Patent: US5248781, 1993, A
[2] Heterocycles, 1994, vol. 38, # 10, p. 2243 - 2246 |
| | 2-Methyl-3-trifluoromethylaniline Preparation Products And Raw materials |
|