|
| 5-Methoxytryptamine hydrochloride Basic information |
| 5-Methoxytryptamine hydrochloride Chemical Properties |
Melting point | 246 °C | storage temp. | 2-8°C | solubility | Methanol | form | crystalline | color | white | Sensitive | Hygroscopic | Merck | 14,6002 | BRN | 3717598 | Stability: | Hygroscopic | InChI | InChI=1S/C11H14N2O.ClH/c1-14-9-2-3-11-10(6-9)8(4-5-12)7-13-11;/h2-3,6-7,13H,4-5,12H2,1H3;1H | InChIKey | TXVAYRSEKRMEIF-UHFFFAOYSA-N | SMILES | NCCC1C2C(=CC=C(OC)C=2)NC=1.[H]Cl | CAS DataBase Reference | 66-83-1(CAS DataBase Reference) |
| 5-Methoxytryptamine hydrochloride Usage And Synthesis |
Chemical Properties | white to beige crystalline powder | Uses | A metabolite of Melatonin | Uses | A closely related compound of the neurotransmitter Melatonin (M215000). | Biochem/physiol Actions | Nonselective serotonin receptor agonist that lacks affinity for the 5-HT3 receptor. |
| 5-Methoxytryptamine hydrochloride Preparation Products And Raw materials |
|