|
|
| | 2-Cyclopropyl-4-(4-fluorophenyl)-quinolyl-3-methanol Basic information |
| | 2-Cyclopropyl-4-(4-fluorophenyl)-quinolyl-3-methanol Chemical Properties |
| Melting point | 134-136°C | | density | 1.286 | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Pale Yellow | | InChI | InChI=1S/C19H16FNO/c20-14-9-7-12(8-10-14)18-15-3-1-2-4-17(15)21-19(13-5-6-13)16(18)11-22/h1-4,7-10,13,22H,5-6,11H2 | | InChIKey | FIZDBNPUFMDGFZ-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=CC=2)C(C2=CC=C(F)C=C2)=C(CO)C=1C1CC1 | | CAS DataBase Reference | 121660-11-5(CAS DataBase Reference) |
| | 2-Cyclopropyl-4-(4-fluorophenyl)-quinolyl-3-methanol Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Pitavastatin intermediate. |
| | 2-Cyclopropyl-4-(4-fluorophenyl)-quinolyl-3-methanol Preparation Products And Raw materials |
|