|
| Methyl 2-(4-methylphenylsulfonamido)acetate Basic information |
Product Name: | Methyl 2-(4-methylphenylsulfonamido)acetate | Synonyms: | methyl 2-(4-methylphenylsulfonamido)acetate;Methyl 2-[(4-Methylbenzene)sulfonaMido]acetate;Methyl N-[(4-methylphenyl)sulphonyl]glycinate, N-Tosylglycine methyl ester, Methyl [(4-methylphenyl)sulphonamido]acetate;N-(Toluene-4-sulphonyl)glycine methyl ester;methyl 2-[(4-methylphenyl)sulfonylamino]acetate;methyltosylglycinate;T0514-7020;TsNHCH2COOCH3 | CAS: | 2645-02-5 | MF: | C10H13NO4S | MW: | 243.28 | EINECS: | | Product Categories: | | Mol File: | 2645-02-5.mol |  |
| Methyl 2-(4-methylphenylsulfonamido)acetate Chemical Properties |
Melting point | 89-91°C | Boiling point | 372.5±52.0 °C(Predicted) | density | 1.261 | storage temp. | Sealed in dry,Room Temperature | solubility | Chloroform (Slightly), Methanol (Slightly) | form | Solid | pka | 9.09±0.50(Predicted) | color | White to Off-White | InChI | InChI=1S/C10H13NO4S/c1-8-3-5-9(6-4-8)16(13,14)11-7-10(12)15-2/h3-6,11H,7H2,1-2H3 | InChIKey | GYQBPYXMRNEAKZ-UHFFFAOYSA-N | SMILES | C(OC)(=O)CNS(C1=CC=C(C)C=C1)(=O)=O |
| Methyl 2-(4-methylphenylsulfonamido)acetate Usage And Synthesis |
| Methyl 2-(4-methylphenylsulfonamido)acetate Preparation Products And Raw materials |
|