| Company Name: |
Suzhou Rovathin Foreign Trade Co.,Ltd
|
| Tel: |
0512-65816829 18662214788 |
| Email: |
info@rovathin.com.cn |
| Products Intro: |
Product Name:2-Ethenyl-4,6-diiodophenol CAS:2298414-64-7 Package:100g
|
| Company Name: |
Shaoyuan Technology (Shanghai) Co., Ltd.
|
| Tel: |
021-50795510 4000665055 |
| Email: |
sy-c6@accelachem.com |
| Products Intro: |
Product Name:2,4-Diiodo-6-vinylphenol CAS:2298414-64-7 Purity:>=95% Package:5g
|
Phenol, 2-ethenyl-4,6-diiodo- manufacturers
|
| | Phenol, 2-ethenyl-4,6-diiodo- Basic information |
| | Phenol, 2-ethenyl-4,6-diiodo- Chemical Properties |
| Boiling point | 327.0±42.0 °C(Predicted) | | density | 2.354±0.06 g/cm3(Predicted) | | pka | 7.69±0.50(Predicted) | | InChI | InChI=1S/C8H6I2O/c1-2-5-3-6(9)4-7(10)8(5)11/h2-4,11H,1H2 | | InChIKey | BSXKPSYPQSEHFE-UHFFFAOYSA-N | | SMILES | C1(O)=C(I)C=C(I)C=C1C=C |
| | Phenol, 2-ethenyl-4,6-diiodo- Usage And Synthesis |
| | Phenol, 2-ethenyl-4,6-diiodo- Preparation Products And Raw materials |
|