| Company Name: |
Anhui Xunrui Chemical Co., Ltd Gold
|
| Tel: |
19159025340 |
| Email: |
sunrui@hfshly.com |
| Products Intro: |
Product Name:1,1'-Biphenyl]-4,4'-diol, 2,2',3,3'-tetrafluoro- CAS:1788080-28-3 Purity:>=98% Package:1KG;10KG;25kg;100kg;吨
|
|
| | [1,1'-Biphenyl]-4,4'-diol, 2,2',3,3'-tetrafluoro- Basic information |
| Product Name: | [1,1'-Biphenyl]-4,4'-diol, 2,2',3,3'-tetrafluoro- | | Synonyms: | [1,1'-Biphenyl]-4,4'-diol, 2,2',3,3'-tetrafluoro-;2,2′,3,3′-Tetrafluoro[1,1′-biphenyl]-4,4′-diol;1,1'-Biphenyl]-4,4'-diol, 2,2',3,3'-tetrafluoro- | | CAS: | 1788080-28-3 | | MF: | C12H6F4O2 | | MW: | 258.17 | | EINECS: | | | Product Categories: | | | Mol File: | 1788080-28-3.mol | ![[1,1'-Biphenyl]-4,4'-diol, 2,2',3,3'-tetrafluoro- Structure](CAS/20210305/GIF/1788080-28-3.gif) |
| | [1,1'-Biphenyl]-4,4'-diol, 2,2',3,3'-tetrafluoro- Chemical Properties |
| Boiling point | 320.5±37.0 °C(Predicted) | | density | 1.532±0.06 g/cm3(Predicted) | | pka | 6.51±0.40(Predicted) | | InChI | InChI=1S/C12H6F4O2/c13-9-5(1-3-7(17)11(9)15)6-2-4-8(18)12(16)10(6)14/h1-4,17-18H | | InChIKey | WRNWYWVQFRENRA-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(O)C(F)=C2F)=CC=C(O)C(F)=C1F |
| | [1,1'-Biphenyl]-4,4'-diol, 2,2',3,3'-tetrafluoro- Usage And Synthesis |
| | [1,1'-Biphenyl]-4,4'-diol, 2,2',3,3'-tetrafluoro- Preparation Products And Raw materials |
|