3-Hydroxy-2-pyrrolidinone manufacturers
|
| | 3-Hydroxy-2-pyrrolidinone Basic information |
| | 3-Hydroxy-2-pyrrolidinone Chemical Properties |
| Melting point | 75 °C | | Boiling point | 194 °C(Press: 10 Torr) | | density | 1.292 | | storage temp. | 2-8°C | | form | solid | | pka | 12.82±0.20(Predicted) | | color | White to light yellow | | Sensitive | Moisture Sensitive | | InChI | InChI=1S/C4H7NO2/c6-3-1-2-5-4(3)7/h3,6H,1-2H2,(H,5,7) | | InChIKey | FRKGSNOMLIYPSH-UHFFFAOYSA-N | | SMILES | N1CCC(O)C1=O |
| | 3-Hydroxy-2-pyrrolidinone Usage And Synthesis |
| Uses | 3-Hydroxy-2-pyrrolidinone is used as a potent inhibitor of CDK2/cyclin A. It is also used as pharmaceutical intermediates. |
| | 3-Hydroxy-2-pyrrolidinone Preparation Products And Raw materials |
|