|
|
| | Allyl-α-D-galactopyranoside Basic information |
| | Allyl-α-D-galactopyranoside Chemical Properties |
| Melting point | 141-145 °C(lit.) | | Boiling point | 415.0±45.0 °C(Predicted) | | density | 1.37±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | pka | 13.01±0.70(Predicted) | | color | White to Off-White | | Optical Rotation | [α]20/D +175°, c = 1.5 in H2O | | InChI | InChI=1/C9H16O6/c1-2-3-14-9-8(13)7(12)6(11)5(4-10)15-9/h2,5-13H,1,3-4H2/t5-,6+,7+,8-,9+/s3 | | InChIKey | XJNKZTHFPGIJNS-NXRLNHOXSA-N | | SMILES | [C@@H]1(OCC=C)[C@H](O)[C@H]([C@@H](O)[C@@H](CO)O1)O |&1:0,5,7,8,10,r| | | CAS DataBase Reference | 48149-72-0(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 29400090 | | Storage Class | 13 - Non Combustible Solids |
| | Allyl-α-D-galactopyranoside Usage And Synthesis |
| Chemical Properties | Off-White Crystalline Solid | | Uses | Allyl-α-D-galactopyranoside can be used as a useful synthetic intermediate for oligosaccharide synthesis. |
| | Allyl-α-D-galactopyranoside Preparation Products And Raw materials |
|