|
|
| | N-Boc-1-aminocyclobutanecarboxylic acid Basic information |
| | N-Boc-1-aminocyclobutanecarboxylic acid Chemical Properties |
| Melting point | 129-133 °C(lit.) | | Boiling point | 362.1±21.0 °C(Predicted) | | density | 1.18±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | pka | 4.14±0.20(Predicted) | | form | Powder | | color | White to light brown | | BRN | 7994003 | | InChI | InChI=1S/C10H17NO4/c1-9(2,3)15-8(14)11-10(7(12)13)5-4-6-10/h4-6H2,1-3H3,(H,11,14)(H,12,13) | | InChIKey | ROVVUKFHORPDSM-UHFFFAOYSA-N | | SMILES | C1(NC(OC(C)(C)C)=O)(C(O)=O)CCC1 | | CAS DataBase Reference | 120728-10-1(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29242990 |
| | N-Boc-1-aminocyclobutanecarboxylic acid Usage And Synthesis |
| Uses | Boc-1-aminocyclobutane-1-carboxylic Acid is used in the synthesis of dipeptidyl nitriles with cathepsin-inhibiting activities. It is also used to prepare alkyl-oxo-aryl amides as novel antagonists of TRPA1 receptor. |
| | N-Boc-1-aminocyclobutanecarboxylic acid Preparation Products And Raw materials |
|