| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Tetrakis(diethylamino)hafnium Basic information |
| Product Name: | Tetrakis(diethylamino)hafnium | | Synonyms: | HAFNIUM DIETHYLAMIDE;TETRAKIS(DIETHYLAMINO)HAFNIUM, 99.99%;Tetrakis(diethylamino)hafnium,99%;tetrakis(diethylamido)hafnium(iv);tetrakis(diethylamino)hafnium(iv);Hafnium, Tetrakis(diethylamino);Tetrakis(diethylamino)hafnium 99.999%;Tetrakis(diethylaMino)hafniuM, 99% (99.99+%-Hf, <0.2% Zr) PURATREM | | CAS: | 19824-55-6 | | MF: | C16H40HfN4 | | MW: | 467.01 | | EINECS: | | | Product Categories: | | | Mol File: | 19824-55-6.mol |  |
| | Tetrakis(diethylamino)hafnium Chemical Properties |
| Melting point | -68 °C | | Boiling point | 130 °C0.01 mm Hg(lit.) | | density | 1.249 g/mL at 25 °C(lit.) | | Fp | 50 °F | | form | liquid | | color | light yellow | | Specific Gravity | 1.249 | | Sensitive | moisture sensitive | | Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents | | InChI | InChI=1S/4C4H10N.Hf/c4*1-3-5-4-2;/h4*3-4H2,1-2H3;/q4*-1;+4 | | InChIKey | VBCSQFQVDXIOJL-UHFFFAOYSA-N | | SMILES | [Hf](N(CC)CC)(N(CC)CC)(N(CC)CC)N(CC)CC |
| Hazard Codes | F,Xi | | Risk Statements | 11-14-36/37/38 | | Safety Statements | 16-26-36 | | RIDADR | UN 3398 4.3/PG 2 | | WGK Germany | 3 | | TSCA | No | | HazardClass | 4.3 | | PackingGroup | II | | Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water | | Hazard Classifications | Eye Irrit. 2
Flam. Liq. 2
Skin Irrit. 2
STOT SE 3
Water-react 2 |
| | Tetrakis(diethylamino)hafnium Usage And Synthesis |
| General Description | Atomic number of base material: 72 Hafnium | | reaction suitability | core: hafnium |
| | Tetrakis(diethylamino)hafnium Preparation Products And Raw materials |
|