- 4-Chlorovalerophenone
-
- $10.00/ kg
-
2024-04-23
- CAS:25017-08-7
- Min. Order: 1kg
- Purity: 99.8%
- Supply Ability: 10000ton
- 4-Chlorovalerophenone
-
- $40.00 / 1kg
-
2024-01-08
- CAS:25017-08-7
- Min. Order: 1kg
- Purity: 99.5%
- Supply Ability: 500tons
|
| | 4-Chlorovalerophenone Basic information |
| Product Name: | 4-Chlorovalerophenone | | Synonyms: | 4-CHLOROVALEROPHENONE;4'-CHLOROPENTANOPHENONE;1-(4-CHLOROPHENYL)-1-PENTANONE;TIMTEC-BB SBB005774;P-CHLOROVALEROPHENONE;1-(4-chlorophenyl)pentan-1-one;1-Pentanone, 1-(4-chlorophenyl)-;1-(4-Chlorophenyl)pentane-1-one | | CAS: | 25017-08-7 | | MF: | C11H13ClO | | MW: | 196.67 | | EINECS: | 246-566-4 | | Product Categories: | Acetophenone Series | | Mol File: | 25017-08-7.mol |  |
| | 4-Chlorovalerophenone Chemical Properties |
| Melting point | 29-33 °C | | Boiling point | 156 °C / 14mmHg | | density | 1.0753 (rough estimate) | | refractive index | 1.5364 (estimate) | | Fp | 30 °C | | storage temp. | Sealed in dry,Room Temperature | | form | fused solid | | color | Off-white to faint yellow | | InChI | InChI=1S/C11H13ClO/c1-2-3-4-11(13)9-5-7-10(12)8-6-9/h5-8H,2-4H2,1H3 | | InChIKey | XMUGWCSIQUJOFA-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(Cl)C=C1)(=O)CCCC | | CAS DataBase Reference | 25017-08-7(CAS DataBase Reference) |
| | 4-Chlorovalerophenone Usage And Synthesis |
| Chemical Properties | white to yellow crystalline low melting solid |
| | 4-Chlorovalerophenone Preparation Products And Raw materials |
|