|
| 2,3,4,5-Tetrahydro-1H-pyrido[4,3-b]indole Basic information |
Product Name: | 2,3,4,5-Tetrahydro-1H-pyrido[4,3-b]indole | Synonyms: | 2,3,4,5-TETRAHYDRO-1H-PYRIDO[4,3-B]INDOLE;AKOS JY2083433;ASINEX-REAG BAS 00107381;CHEMBRDG-BB 4110640;TIMTEC-BB SBB004411;2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole(SALTDATA: FREE);1H,2H,3H,4H,5H-pyrido[4,3-b]indole;2,3,4,5-Tetrahydro-1H-pyrido[4,3-b]indole AldrichCPR | CAS: | 6208-60-2 | MF: | C11H12N2 | MW: | 172.23 | EINECS: | | Product Categories: | Indole | Mol File: | 6208-60-2.mol | ![2,3,4,5-Tetrahydro-1H-pyrido[4,3-b]indole Structure](CAS/GIF/6208-60-2.gif) |
| 2,3,4,5-Tetrahydro-1H-pyrido[4,3-b]indole Chemical Properties |
Boiling point | 351.6±32.0 °C(Predicted) | density | 1.189±0.06 g/cm3(Predicted) | storage temp. | 2-8°C(protect from light) | form | solid | pka | 17.77±0.20(Predicted) | InChI | InChI=1S/C11H12N2/c1-2-4-10-8(3-1)9-7-12-6-5-11(9)13-10/h1-4,12-13H,5-7H2 | InChIKey | RPROHCOBMVQVIV-UHFFFAOYSA-N | SMILES | N1C2=C(C=CC=C2)C2CNCCC1=2 | CAS DataBase Reference | 6208-60-2(CAS DataBase Reference) |
Hazard Codes | Xi | Risk Statements | 36 | Safety Statements | 26 | WGK Germany | 3 | HazardClass | IRRITANT | HS Code | 2933998090 |
| 2,3,4,5-Tetrahydro-1H-pyrido[4,3-b]indole Usage And Synthesis |
| 2,3,4,5-Tetrahydro-1H-pyrido[4,3-b]indole Preparation Products And Raw materials |
|