| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
|
| | cyclohex-3-ene-1,6-dicarboxylic acid Basic information |
| Product Name: | cyclohex-3-ene-1,6-dicarboxylic acid | | Synonyms: | cyclohex-3-ene-1,6-dicarboxylic acid;(1R,2R)-cyclohex-4-ene-1,2-dicarboxylic acid;4-Cyclohexene-1,2-dicarboxylic acid, (1R,2R)-rel-;(+/-)-trans-4-Cyclohexene-1,2-dicarboxylic acid;(R,R)-rel-Cyclohex-4-ene-1,2-dicarboxylic Acid;rac-trans-4-Cyclohexene-1,2-dicarboxylic acid;(±)-trans-4-Cyclohexene-1,2-dicarboxylic acid;(±)-trans-4-Cyclohexene-1,2-dicarboxylic acid | | CAS: | 15573-40-7 | | MF: | C8H10O4 | | MW: | 170.16 | | EINECS: | | | Product Categories: | | | Mol File: | 15573-40-7.mol |  |
| | cyclohex-3-ene-1,6-dicarboxylic acid Chemical Properties |
| Melting point | 170 °C(Solv: water (7732-18-5)) | | Boiling point | 395.4±42.0 °C(Predicted) | | density | 1.369±0.06 g/cm3(Predicted) | | pka | 3.99±0.40(Predicted) | | form | solid | | color | White | | BRN | 3201285 | | InChI | 1S/C8H10O4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-2,5-6H,3-4H2,(H,9,10)(H,11,12)/t5-,6-/m1/s1 | | InChIKey | ILUAAIDVFMVTAU-PHDIDXHHSA-N | | SMILES | OC(=O)[C@@H]1CC=CC[C@H]1C(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2917198090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | cyclohex-3-ene-1,6-dicarboxylic acid Usage And Synthesis |
| Uses | (R,R)-Cyclohex-4-ene-1,2-dicarboxylic Acid, is a building block used in various chemical synthesis, such as in preparation of lurasidone (L474920), an antipsychotic used for treatment of schizophrenia. |
| | cyclohex-3-ene-1,6-dicarboxylic acid Preparation Products And Raw materials |
|