|
|
| | OENIN CHLORIDE Basic information |
| Product Name: | OENIN CHLORIDE | | Synonyms: | 3-(beta-D-glucopyranosyloxy)-5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-1-benzopyrylium chloride;MALVIDIN3-O-GLUCOSIDE;malvidin-3-O-gluoenin chlorideenin chloride cyclamin chloride;Malvidin 3-O-β-D-glucopyranoside;Einecs 230-631-9;Nsc 70532;Malvinidin 3-glucoside chloride;Enoside | | CAS: | 7228-78-6 | | MF: | C23H25ClO12 | | MW: | 528.89 | | EINECS: | 230-631-9 | | Product Categories: | Anthocyanins | | Mol File: | 7228-78-6.mol |  |
| | OENIN CHLORIDE Chemical Properties |
| storage temp. | -20°C | | solubility | Soluble in methan | | form | powder | | color | Red-black | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChIKey | YDIKCZBMBPOGFT-DIONPBRTSA-N | | SMILES | [Cl-].COc1cc(cc(OC)c1O)-c2[o+]c3cc(O)cc(O)c3cc2O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O |
| WGK Germany | 3 | | F | 10-21 | | HS Code | 29389090 | | Storage Class | 11 - Combustible Solids |
| | OENIN CHLORIDE Usage And Synthesis |
| Chemical Properties | sparingly soluble in water and alcohol | | Uses | Anthocyanin. neuroprotective agent | | Uses | Oenin Chloride is an anthocyanin compound and the 3-glucoside conjugate of Malvidin. Oenin is found in the skin of purple grapes and blueberries and is a potential anti-inflammatory agent. | | General Description | Oenin chloride/malvidin-3-O-glucoside is an anthocyanin content, present at high level in Vitis vinifera?young red wines. It helps in defining the colour of wine. | | Biochem/physiol Actions | Anthocyanin. Studied for its neuroprotective properties. |
| | OENIN CHLORIDE Preparation Products And Raw materials |
|