| Company Name: |
Suzhou A-Photoelectic Materials Co.,Ltd Gold
|
| Tel: |
18913195221 |
| Email: |
szaw2018@163.com |
| Products Intro: |
Product Name:9,9-Dimethyl-2,7-bis[N-(1-naphthyl)-N-phenylamino]fluorene CAS:222319-05-3 Purity:98 Package:100g;1000g;10g
|
9,9-Dimethyl-2,7-bis[N-(1-naphthyl)-N-phenylamino]fluorene manufacturers
|
| | 9,9-Dimethyl-2,7-bis[N-(1-naphthyl)-N-phenylamino]fluorene Basic information |
| Product Name: | 9,9-Dimethyl-2,7-bis[N-(1-naphthyl)-N-phenylamino]fluorene | | Synonyms: | 9,9-Dimethyl-2,7-bis[N-(1-naphthyl)-N-phenylamino]fluorene;9,9-dimethyl-N2,N7-di(naphthalen-1-yl)-N2,N7-diphenyl-9H-fluorene-2,7-diamine;2,7-Bis[N-(1-naphthyl)anilino]-9,9-dimethylfluorene;2,7-Bis[N-(1-naphthyl)anilino]-9,9-dimethylfluorene;9,9-Dimethyl-N,N′-di(1-naphthyl)-N,N′-diphenyl-9H-fluorene-2,7-diamine;9,9-dimethyl-2-N,7-N-dinaphthalen-1-yl-2-N,7-N-diphenylfluorene-2,7-diamine;9H-Fluorene-2,7-diamine, 9,9-dimethyl-N2,N7-di-1-naphthalenyl-N2,N7-diphenyl-;9,9-Dimethyl-N,N′-di(1-naphthyl)-N,N′-diphenyl-9H-fluorene-2,7-diamine | | CAS: | 222319-05-3 | | MF: | C47H36N2 | | MW: | 628.8 | | EINECS: | | | Product Categories: | Electronic Chemicals | | Mol File: | 222319-05-3.mol | ![9,9-Dimethyl-2,7-bis[N-(1-naphthyl)-N-phenylamino]fluorene Structure](CAS/GIF/222319-05-3.gif) |
| | 9,9-Dimethyl-2,7-bis[N-(1-naphthyl)-N-phenylamino]fluorene Chemical Properties |
| Melting point | 265-270°C | | density | 1+-.0.06 g/cm3(Predicted) | | storage temp. | RT, protect from light | | pka | -0.14±0.40(Predicted) | | form | powder to crystal | | color | White to Orange to Green | | InChIKey | KJEQVQJWXVHKGT-UHFFFAOYSA-N | | SMILES | C1(C)(C)C2=C(C=CC(N(C3=C4C(C=CC=C4)=CC=C3)C3=CC=CC=C3)=C2)C2=C1C=C(N(C1=C3C(C=CC=C3)=CC=C1)C1=CC=CC=C1)C=C2 |
| WGK Germany | 3 | | HS Code | 2921.59.8090 | | Storage Class | 13 - Non Combustible Solids |
| | 9,9-Dimethyl-2,7-bis[N-(1-naphthyl)-N-phenylamino]fluorene Usage And Synthesis |
| Uses | This material is a common hole transport material for OLED devices |
| | 9,9-Dimethyl-2,7-bis[N-(1-naphthyl)-N-phenylamino]fluorene Preparation Products And Raw materials |
|