- DHQ
-
- $110.00 / 500mg
-
2025-12-05
- CAS:15804-19-0
- Min. Order:
- Purity: 100.00%
- Supply Ability: 10g
|
| | 2,3-DIHYDROXYQUINOXALINE Basic information |
| Product Name: | 2,3-DIHYDROXYQUINOXALINE | | Synonyms: | 1,4-Dihydro-2,3-quinoxalinedione;1,4-dihydro-3-quinoxalinedione;2,3(1h,4h)-quinoxalinedione;2,3-dihydroxy-quinoxalin;2,3-Quinoxalinedione, 1,4-dihydro-;2,3-Quinoxalinedione,1,4-dihydro-;Quinoxaline, 2,3-dihydroxy-;USAF ek-6232 | | CAS: | 15804-19-0 | | MF: | C8H6N2O2 | | MW: | 162.15 | | EINECS: | 239-901-0 | | Product Categories: | Bioactive Small Molecules;Building Blocks;Cell Biology;Chemical Synthesis;DIG-DY;Heterocyclic Building Blocks;Quinoxalines;Quinolines, Quinazolines and derivatives | | Mol File: | 15804-19-0.mol |  |
| | 2,3-DIHYDROXYQUINOXALINE Chemical Properties |
| Melting point | >300 °C (lit.) | | Boiling point | 288.82°C (rough estimate) | | density | 1.3264 (rough estimate) | | refractive index | 1.5770 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | form | powder to crystaline | | pka | 10.66±0.20(Predicted) | | color | White to Orange to Green | | BRN | 136884 | | InChI | InChI=1S/C8H6N2O2/c11-7-8(12)10-6-4-2-1-3-5(6)9-7/h1-4H,(H,9,11)(H,10,12) | | InChIKey | ABJFBJGGLJVMAQ-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC=C2)NC(=O)C1=O | | CAS DataBase Reference | 15804-19-0(CAS DataBase Reference) | | EPA Substance Registry System | 2,3-Quinoxalinedione, 1,4-dihydro- (15804-19-0) |
| | 2,3-DIHYDROXYQUINOXALINE Usage And Synthesis |
| Chemical Properties | off-white powder | | Uses | 2,3-Dihydroxyquinoxaline is a fluorescent reagent and it can be used for the determination of trace Pb(II) in vinegar. | | Application | 2,3-Dihydroxyquinoxaline can be used:
(1) Basic chemical studies to determine the low-temperature x-ray molecular structure, reciprocal isomerism and spectroscopic properties of 2,3-Dihydroxyquinoxaline[1].
(2) Quinoline-5-carboxamide derivatives (Vq-Vu) and (VIa-Vu) were prepared by using methyl 2,3-diaminobenzoate as raw material[2].
| | General Description | 2,3-Dihydroxyquinoxaline(dhq) undergoes electrophilic substitution reaction with sulphuric acid solution and potassium nitrate to form 2,3-dihydroxy-6-nitroquinoxaline. It reacts with Ru3(CO)12 in DMSO to give the Ru(CO)2(dhq)(DMSO) complex. | | References | [1] SAIED M. SOLIMAN; Morsy A M A Y; J?rg Albering. Low temperature X-ray molecular structure, tautomerism and spectral properties of 2,3-dihydroxyquinoxaline[J]. Journal of Molecular Structure, 2013. DOI:10.1016/j.molstruc.2013.09.005.
[2] KEESARI SRINIVAS. Synthesis, Characterization, and Antibacterial Activity of Novel 2,3-Dihydroxyquinoxaline-5-сarboxamide Derivatives[J]. Russian Journal of Bioorganic Chemistry, 2023. DOI:10.1134/S106816202305014X.
|
| | 2,3-DIHYDROXYQUINOXALINE Preparation Products And Raw materials |
|