|
| 3,5-Dimethylbenzoyl chloride Basic information |
Product Name: | 3,5-Dimethylbenzoyl chloride | Synonyms: | 3,5-dimethyl-benzoylchlorid;3,5-DIMETHYLBENZOYL CHLORIDE;3,5-DimethylbenzoicChloride;Benzoyl chloride, 3,5-dimethyl- (6CI,7CI,8CI,9CI);3,5-Dimethylbenzoyl;m-xylene-5-carbonyl chloride;Benzoylchloride,3,5-dimethyl-;3,5-Dimethylbenzoic acid chloride | CAS: | 6613-44-1 | MF: | C9H9ClO | MW: | 168.62 | EINECS: | 413-010-9 | Product Categories: | ACIDHALIDE | Mol File: | 6613-44-1.mol | |
| 3,5-Dimethylbenzoyl chloride Chemical Properties |
Boiling point | 127 °C / 20mmHg | density | 1.14 | vapor pressure | 5.2Pa at 25℃ | refractive index | 1.5440-1.5480 | form | clear liquid | color | Colorless to Light yellow | InChI | InChI=1S/C9H9ClO/c1-6-3-7(2)5-8(4-6)9(10)11/h3-5H,1-2H3 | InChIKey | ZJIOBDJEKDUUCI-UHFFFAOYSA-N | SMILES | C(Cl)(=O)C1=CC(C)=CC(C)=C1 | LogP | 2.85 | CAS DataBase Reference | 6613-44-1(CAS DataBase Reference) | EPA Substance Registry System | Benzoyl chloride, 3,5-dimethyl- (6613-44-1) |
Hazard Codes | C | Risk Statements | 34-43 | Safety Statements | 26-36/37/39-45 | RIDADR | 3265 | RTECS | DM6636900 | HazardClass | 8 | PackingGroup | III | HS Code | 2916399050 |
| 3,5-Dimethylbenzoyl chloride Usage And Synthesis |
Uses | 3,5-Dimethylbenzoyl Chloride-d9 is an intermediate in the synthesis of Methoxyfenozide-d9 (M262768), deuterium labelled Methoxyfenozide (M262765). It is used primarily as an insecticide, and pesticide. |
| 3,5-Dimethylbenzoyl chloride Preparation Products And Raw materials |
|