|
|
| | Tolperisone hydrochloride Basic information |
| Product Name: | Tolperisone hydrochloride | | Synonyms: | 1-piperidino-2-methyl-3-(p-tolyl)-3-propanonehydrochloride;LABOTEST-BB LT00772344;2-Methyl-1-(4-methylphenyl)-3-(1-piperidyl)propan-1-one hydrochloride;Tolperizone hydrochloride;4'-METHYL-2-(1-PIPERIDINYLMETHYL)-PROPIOPHENONE HCL;4'-methyl-2-(1-piperidinylmethyl)-propiophenone hydrochloride;2,4'-DIMETHYL-3-PIPERIDINOPROPIOPHENONE HYDROCHLORIDE;2,4'-dimethyl-3-piperidinopropiophenone monohydrochloride | | CAS: | 3644-61-9 | | MF: | C16H24ClNO | | MW: | 281.82 | | EINECS: | 222-876-5 | | Product Categories: | Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 3644-61-9.mol |  |
| | Tolperisone hydrochloride Chemical Properties |
| Melting point | 181-183°C | | storage temp. | room temp | | solubility | H2O: >20mg/mL | | form | solid | | color | white | | PH | pH(50g/l, 25℃) : 4.5~5.5 | | Water Solubility | almost transparency | | Merck | 14,9522 | | InChI | InChI=1S/C16H23NO.ClH/c1-13-6-8-15(9-7-13)16(18)14(2)12-17-10-4-3-5-11-17;/h6-9,14H,3-5,10-12H2,1-2H3;1H | | InChIKey | ZBUVYROEHQQAKL-UHFFFAOYSA-N | | SMILES | C1(=CC=C(C)C=C1)C(=O)C(C)CN1CCCCC1.Cl | | CAS DataBase Reference | 3644-61-9(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-52/53-36/37/38 | | Safety Statements | 26-36-45-61-36/37-37/39 | | WGK Germany | 3 | | RTECS | UH1575500 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral | | Toxicity | LD50 s.c. in mice: 620 mg/kg (Porszasz, 1961) |
| | Tolperisone hydrochloride Usage And Synthesis |
| Chemical Properties | White Solid | | Originator | Tolperisone hydrochloride,Shanghai Abochem
Chemical Co. | | Uses | Tolperisone hydrochloride can be used as a muscle relaxant. | | Definition | ChEBI: Tolperisone hydrochloride is an aromatic ketone. | | Manufacturing Process | To 1-(4-methylphenyl)-3-(1-piperidinyl)-1-propanol in chloroform was added
an excess of thionyl chloride and the reaction mixture refluxed until
completed. It was then taken to dryness under reduced pressure and the
residue crystallized by dissolving in hot alcohol and diluting with ethyl acetate.
An aqueous solution of the obtained N-[3-chloro-3-(p-tolyl)propyl]piperidine
hydrochloride was hydrogenated at 3 atmospheres in the presence of buffered
palladium-on-charcoal catalyst. 1-Piperidino-2-methyl-3-(p-tolyl)-3-propanone
was purified by distilling the base (boiling point 106-107°C/1 mm) and
reconverting to the hydrochloride, melting point 216-217°C. | | Therapeutic Function | Muscle relaxant, Vasodilator | | Biochem/physiol Actions | Tolperisone is derived from piperidine and possesses membrane stabilizing action. It helps in reducing the effect of spasticities associated with the nervous and muscular system. It exhibits muscle relaxant action through attenuating voltage-gated sodium channels in the brain stem. |
| | Tolperisone hydrochloride Preparation Products And Raw materials |
|