|
| 2,5-Dimethylphenylacetic acid Basic information |
Product Name: | 2,5-Dimethylphenylacetic acid | Synonyms: | RARECHEM AL BO 0306;2,5-DIMETHYLPHENYLACETIC ACID,98+%;ASISCHEM D13366;(2,4-XYLYL)ACETIC ACID;2,5-XYLYLACETIC ACID;2,5-DIMETHYLPHENYLACETIC ACID;2,5-Dimethylphenylacetic acid(2,5-Xylylacetic acid);2,5-DiMethylphenylacetic acid, 98% 5GR | CAS: | 13612-34-5 | MF: | C10H12O2 | MW: | 164.2 | EINECS: | 237-097-6 | Product Categories: | Aromatic Phenylacetic Acids and Derivatives;13612-34-5 | Mol File: | 13612-34-5.mol |  |
| 2,5-Dimethylphenylacetic acid Chemical Properties |
Melting point | 128-130°C | Boiling point | 293.4±9.0 °C(Predicted) | density | 1.098±0.06 g/cm3(Predicted) | storage temp. | Sealed in dry,Room Temperature | pka | 4.31±0.10(Predicted) | form | Crystalline Powder | color | Light beige | BRN | 2502313 | InChI | InChI=1S/C10H12O2/c1-7-3-4-8(2)9(5-7)6-10(11)12/h3-5H,6H2,1-2H3,(H,11,12) | InChIKey | RUSCTNYOPQOXDJ-UHFFFAOYSA-N | SMILES | C1(CC(O)=O)=CC(C)=CC=C1C | CAS DataBase Reference | 13612-34-5(CAS DataBase Reference) |
| 2,5-Dimethylphenylacetic acid Usage And Synthesis |
| 2,5-Dimethylphenylacetic acid Preparation Products And Raw materials |
Raw materials | Benzeneacetic acid, 2,5-diMethyl-, ethyl ester-->2,5-DIMETHYLPHENETHYL ALCOHOL-->Ethanone, 2-chloro-1-(2,5-dimethylphenyl)- (9CI)-->2',5'-DIMETHYLACETOPHENONE-->2,5-Dimethylphenylacetonitrile-->2,5-Dimethylbenzyl chloride-->2,5-DIMETHYLBENZYL BROMIDE-->4-Methylbenzyl alcohol-->Sodium acetate-->carbon monoxide-->Carbon dioxide-->P-XYLENE-->Ethylene glycol | Preparation Products | 2,5-Dimethylphenylacetyl chloride |
|