| Company Name: |
Shanghai Latchem Co., Ltd. Gold
|
| Tel: |
021-61916491 15921747686 |
| Email: |
sales@latcheminc.com |
| Products Intro: |
Product Name:(2R,3S)-Rel-2,3-bis(4-chlorophenyl)-2,3-butanediaMine
CAS:939983-16-1
Purity:95% HPLC Package:1g 5g 10g 少量现货
|
|
| | (2R,3S)-Rel-2,3-bis(4-chlorophenyl)-2,3-butanediaMine Basic information |
| Product Name: | (2R,3S)-Rel-2,3-bis(4-chlorophenyl)-2,3-butanediaMine | | Synonyms: | 2,3-ButanediaMine, 2,3-bis(4-chlorophenyl)-, (2R,3S)-rel-;4,4'-((2R,3S)-Butane-2,3-diyl)bis(chlorobenzene);(2R,3S)-rel-2,3-Bis(4-chlorophenyl)butane-2,3-diamine;(2S,3R)-2,3-bis(4-chlorophenyl)butane-2,3-diamine;(2R,3S)-Rel-2,3-bis(4-chlorophenyl)-2,3-butanediaMine;rel-(2R,3S)-2,3-Bis(4-chlorophenyl)-2,3-butanediamine;rel-(2R,3S)-2,3-Bis(4-chlorophenyl)butane-2,3-diamine | | CAS: | 939983-16-1 | | MF: | C16H18Cl2N2 | | MW: | 309.23 | | EINECS: | | | Product Categories: | | | Mol File: | 939983-16-1.mol |  |
| | (2R,3S)-Rel-2,3-bis(4-chlorophenyl)-2,3-butanediaMine Chemical Properties |
| storage temp. | 2-8°C, protect from light | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1/C16H18Cl2N2/c1-15(19,11-3-7-13(17)8-4-11)16(2,20)12-5-9-14(18)10-6-12/h3-10H,19-20H2,1-2H3/t15-,16+ | | InChIKey | LWRJAHOWKXOLSQ-IYBDPMFKNA-N | | SMILES | C[C@](C1=CC=C(Cl)C=C1)(N)[C@](C1=CC=C(Cl)C=C1)(N)C |&1:1,10,r| |
| | (2R,3S)-Rel-2,3-bis(4-chlorophenyl)-2,3-butanediaMine Usage And Synthesis |
| | (2R,3S)-Rel-2,3-bis(4-chlorophenyl)-2,3-butanediaMine Preparation Products And Raw materials |
|