|
|
| | Guanosine-5'-triphosphoric aicd disodium salt Basic information |
| | Guanosine-5'-triphosphoric aicd disodium salt Chemical Properties |
| Melting point | 180°C | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | PBS (pH 7.2): 10 mg/ml | | form | Powder | | color | White | | Water Solubility | Soluble in water. | | InChIKey | XIZYETZGWBYYEH-NGPBCCOENA-N | | SMILES | O[C@@H]1[C@@H]([C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O[C@H]1N1C=NC2C(NC(N)=NC1=2)=O)O.[NaH] |&1:1,2,3,19,r| | | CAS DataBase Reference | 56001-37-7(CAS DataBase Reference) |
| | Guanosine-5'-triphosphoric aicd disodium salt Usage And Synthesis |
| Chemical Properties | White crystalline powder | | Uses | Guanosine 5?-triphosphate (GTP), a purine trinucleotide, is a substrate for RNA polymerases and a wide range of GTPase including G-protein coupled receptor (GPCR) GTPases and cell signaling and cycling associated guanine nucleotide exhange factors (GEF). Guanosine 5?-Triphosphate, Disodium Salt is a phosphoryl donor in protein synthesis and in signal transduction. | | Uses | A phosphoryl donor in protein synthesis and signal transduction |
| | Guanosine-5'-triphosphoric aicd disodium salt Preparation Products And Raw materials |
|