AZOMETHINE H manufacturers
- AZOMETHINE H
-
- $5.00 / 1KG
-
2025-09-25
- CAS:5941-07-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | AZOMETHINE H Basic information |
| Product Name: | AZOMETHINE H | | Synonyms: | 4-HYDROXY-5-[SALICYLIDENEAMINO]-2,7-NAPHTHALENEDISULFONIC ACID SODIUM SALT;8-HYDROXY-1-(SALICYLIDENEAMINO)NAPHTHALENE-3,6-DISULFONIC ACID MONOSODIUM SALT;AZOMETHINE H;AZOMETHINE-H SODIUM SALT;Azomethine-H Monosodium Salt;2,7-Naphthalenedisulfonic acid, 4-hydroxy-5-(2-hydroxyphenyl)methyleneamino-, monosodium salt;Azomethine H [Spectrophotometric Reagent for B];8-Hydroxy-1-(salicylideneamino)naphthalene-3,6-disulfonic acid 6-sodium salt | | CAS: | 5941-07-1 | | MF: | C17H14NNaO8S2 | | MW: | 447.41 | | EINECS: | 227-698-1 | | Product Categories: | API intermediates;Analytical Chemistry;Bipyridyls, etc. (Chelating Reagents);Chelating Reagents | | Mol File: | 5941-07-1.mol |  |
| | AZOMETHINE H Chemical Properties |
| Melting point | >300°C | | bulk density | 500kg/m3 | | storage temp. | Store at +15°C to +25°C. | | Water Solubility | Soluble in water | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Powder | | color | Bright orange | | InChI | InChI=1S/C17H13NO8S2.Na.H/c19-15-4-2-1-3-10(15)9-18-14-7-12(27(21,22)23)5-11-6-13(28(24,25)26)8-16(20)17(11)14;;/h1-9,19-20H,(H,21,22,23)(H,24,25,26);;/b18-9+;; | | InChIKey | MLMFPVVHWYCLSL-IFJQNBRBSA-N | | SMILES | N(/C1=CC(S(O)(=O)=O)=CC2=CC(S(O)(=O)=O)=CC(O)=C12)=C\C1C=CC=CC=1O.[NaH] | | CAS DataBase Reference | 5941-07-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 32041400 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | AZOMETHINE H Usage And Synthesis |
| Uses | Azomethine-H Monosodium is used to make optically transparent thin films with photochromic properties. |
| | AZOMETHINE H Preparation Products And Raw materials |
|