| Company Name: |
TCI Europe |
| Tel: |
320-37350700 |
| Email: |
sales@tcieurope.eu |
|
| | 2-Propenoic acid 1-ethylcyclopentyl ester Basic information |
| Product Name: | 2-Propenoic acid 1-ethylcyclopentyl ester | | Synonyms: | 1-Ethylcyclopentyl acrylate;2-Propenoic acid 1-ethylcyclopentyl ester;1-Ethylcyclopentyl Acrylate (stabilized with MEHQ);Acrylic Acid 1-Ethylcyclopentyl Ether;ECPA;ETCPA;1-Ethylcyclopentyl 2-propenoate;2-Acryloxy-1-ethylcyclopentyl acetate | | CAS: | 326925-69-3 | | MF: | C10H16O2 | | MW: | 168.23 | | EINECS: | | | Product Categories: | | | Mol File: | 326925-69-3.mol |  |
| | 2-Propenoic acid 1-ethylcyclopentyl ester Chemical Properties |
| Boiling point | 206℃ | | density | 0.96 | | Fp | 75℃ | | form | clear liquid | | color | Colorless to Almost colorless | | InChI | InChI=1S/C10H16O2/c1-3-9(11)12-10(4-2)7-5-6-8-10/h3H,1,4-8H2,2H3 | | InChIKey | FDOANYJWOYTZAP-UHFFFAOYSA-N | | SMILES | C(OC1(CC)CCCC1)(=O)C=C |
| | 2-Propenoic acid 1-ethylcyclopentyl ester Usage And Synthesis |
| | 2-Propenoic acid 1-ethylcyclopentyl ester Preparation Products And Raw materials |
|