|
|
| | 2,5-DIMETHYL-3-FUROIC ACID Basic information |
| Product Name: | 2,5-DIMETHYL-3-FUROIC ACID | | Synonyms: | TIMTEC-BB SBB004165;2,5-DIMETHYLFURAN-3-CARBOXYLIC ACID;2,5-DIMETHYL-3-FUROIC ACID;2,5-DIMETHYL-3-FURANCARBOXYLIC ACID;pyrotritaric acid;2,5-DIMETHYL-3-FUORIC ACID;2,5-Dimethyl-3-furoic acid,98%;2,5-Dimethyl-3-furoic acid2,5-Dimethylfuran-3-carboxylic acid | | CAS: | 636-44-2 | | MF: | C7H8O3 | | MW: | 140.14 | | EINECS: | 211-257-5 | | Product Categories: | Carboxylic Acids;Furans, Benzofurans & Dihydrobenzofurans;Carboxylic Acids;Furans, Benzofurans & Dihydrobenzofurans | | Mol File: | 636-44-2.mol |  |
| | 2,5-DIMETHYL-3-FUROIC ACID Chemical Properties |
| Melting point | 137-140 °C (lit.) | | Boiling point | 240.6±35.0 °C(Predicted) | | density | 1.194±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 4.56±0.26(Predicted) | | form | powder to crystaline | | color | White to Orange to Green | | InChI | InChI=1S/C7H8O3/c1-4-3-6(7(8)9)5(2)10-4/h3H,1-2H3,(H,8,9) | | InChIKey | CNTHHNPBADVTRY-UHFFFAOYSA-N | | SMILES | O1C(C)=CC(C(O)=O)=C1C | | CAS DataBase Reference | 636-44-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | 3261 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29321900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2,5-DIMETHYL-3-FUROIC ACID Usage And Synthesis |
| Chemical Properties | white to faint yellow crystalline powder | | Uses | 2,5-Dimethyl-3-furoic acid may be used as carboxylato ligand in the preparation of the following titanocene complexes:
- [Ti(η5-C5H5)2(OOC-dmf)2]
- [Ti(η5-C5H4Me)2(OOC-dmf)2]
|
| | 2,5-DIMETHYL-3-FUROIC ACID Preparation Products And Raw materials |
|