|
|
| | 4-(1,2,2-triphenyl vinyl)benzoic acid Basic information | | Application |
| Product Name: | 4-(1,2,2-triphenyl vinyl)benzoic acid | | Synonyms: | 4-(1,2,2-triphenyl vinyl)benzoic acid;1-(4-Carboxyphenyl)-1,2,2-triphenylethene;Benzoic acid, 4-(1,2,2-triphenylethenyl)-;4-(1,2,2-triphenyl vinyl)benzoic acid ISO 9001：2015 REACH;4-(1,2,2-triphenylethenyl)benzoic acid;DK7683 | | CAS: | 197153-87-0 | | MF: | C27H20O2 | | MW: | 376.45 | | EINECS: | | | Product Categories: | | | Mol File: | 197153-87-0.mol |  |
| | 4-(1,2,2-triphenyl vinyl)benzoic acid Chemical Properties |
| Boiling point | 503.8±29.0 °C(Predicted) | | density | 1.183±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 4.27±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C27H20O2/c28-27(29)24-18-16-23(17-19-24)26(22-14-8-3-9-15-22)25(20-10-4-1-5-11-20)21-12-6-2-7-13-21/h1-19H,(H,28,29) | | InChIKey | BYQULXPMSUDNFL-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(/C(/C2=CC=CC=C2)=C(\C2=CC=CC=C2)/C2=CC=CC=C2)C=C1 |
| | 4-(1,2,2-triphenyl vinyl)benzoic acid Usage And Synthesis |
| Application | 4-(1,2,2-triphenylvinyl)benzoic acid can be used in the field of organic chemical industry, such as to prepare an activated luminescent material. Different biomolecules are combined on 4-(1,2,2-triphenylvinyl)benzoic acid through condensation reaction to obtain a biocompatible activated luminescent material with AIE/AE properties. |
| | 4-(1,2,2-triphenyl vinyl)benzoic acid Preparation Products And Raw materials |
|